Difference between revisions of "PWY-6737"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=HEXANOYL-COA HEXANOYL-COA] == * smiles: ** CCCCCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)...")
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-6737 PWY-6737] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2157 TAX-21...")
 
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Pathway]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=HEXANOYL-COA HEXANOYL-COA] ==
+
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-6737 PWY-6737] ==
* smiles:
+
* taxonomic range:
** CCCCCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2157 TAX-2157]
* inchi key:
+
** InChIKey=OEXFMSFODMQEPE-HDRQGHTBSA-J
+
 
* common name:
 
* common name:
** hexanoyl-CoA
+
** starch degradation V
* molecular weight:
+
** 861.647   
+
 
* Synonym(s):
 
* Synonym(s):
** hexanoyl-coenzyme A
 
  
== Reaction(s) known to consume the compound ==
+
== Reaction(s) found ==
== Reaction(s) known to produce the compound ==
+
'''1''' reactions found over '''4''' reactions in the full pathway
== Reaction(s) of unknown directionality ==
+
* [[PHOSPHOGLUCMUT-RXN]]
* [[RXN-14277]]
+
** 1 associated gene(s):
 +
*** [[Ec-17_001480]]
 +
** 1 reconstruction source(s) associated:
 +
*** [[annotation-esiliculosus_genome]]
 +
== Reaction(s) not found ==
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-12171 RXN-12171]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-12190 RXN-12190]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-12193 RXN-12193]
 
== External links  ==
 
== External links  ==
* CAS : 5060-32-2
+
{{#set: taxonomic range=TAX-2157}}
* BIGG : 45470
+
{{#set: common name=starch degradation V}}
* DRUGBANK : DB02563
+
{{#set: reaction found=1}}
* PUBCHEM:
+
{{#set: total reaction=4}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=53262356 53262356]
+
{{#set: completion rate=25.0}}
* HMDB : HMDB02845
+
* LIGAND-CPD:
+
** [http://www.genome.jp/dbget-bin/www_bget?C05270 C05270]
+
* CHEBI:
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=62620 62620]
+
* METABOLIGHTS : MTBLC27540
+
{{#set: smiles=CCCCCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]}}
+
{{#set: inchi key=InChIKey=OEXFMSFODMQEPE-HDRQGHTBSA-J}}
+
{{#set: common name=hexanoyl-CoA}}
+
{{#set: molecular weight=861.647    }}
+
{{#set: common name=hexanoyl-coenzyme A}}
+
{{#set: reversible reaction associated=RXN-14277}}
+

Latest revision as of 19:32, 21 March 2018

Pathway PWY-6737

  • taxonomic range:
  • common name:
    • starch degradation V
  • Synonym(s):

Reaction(s) found

1 reactions found over 4 reactions in the full pathway

Reaction(s) not found

External links