Difference between revisions of "RXN66-469"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=PHENYL-PYRUVATE PHENYL-PYRUVATE] == * smiles: ** C([O-])(=O)C(=O)CC1(=CC=CC=C1) * inchi key: **...") |
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN66-469 RXN66-469] == * direction: ** LEFT-TO-RIGHT * common name: ** 3-methyl-branched fatty acy...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Reaction]] |
− | == | + | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN66-469 RXN66-469] == |
− | * | + | * direction: |
− | ** | + | ** LEFT-TO-RIGHT |
− | + | ||
− | + | ||
* common name: | * common name: | ||
− | ** | + | ** 3-methyl-branched fatty acyl-CoA ligase |
− | * | + | ** long chain acyl-coA synthetase |
− | ** | + | ** long chain acyl-CoA synthetase |
+ | * ec number: | ||
+ | ** [http://enzyme.expasy.org/EC/6.2.1.3 EC-6.2.1.3] | ||
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | |||
− | |||
− | |||
− | == Reaction | + | == Reaction Formula == |
− | * [[ | + | * With identifiers: |
− | + | ** 1 [[CO-A]][c] '''+''' 1 [[ATP]][c] '''+''' 1 [[3-Methyl-Saturated-Fatty-Acids]][c] '''=>''' 1 [[AMP]][c] '''+''' 1 [[PPI]][c] '''+''' 1 [[3-Methyl-Saturated-Fatty-Acyl-CoA]][c] | |
− | + | * With common name(s): | |
− | == | + | ** 1 coenzyme A[c] '''+''' 1 ATP[c] '''+''' 1 a 3-methyl-branched 2,3,4-saturated fatty acid[c] '''=>''' 1 AMP[c] '''+''' 1 diphosphate[c] '''+''' 1 a 3-methyl-branched 2,3,4-saturated fatty acyl-CoA[c] |
− | * [[ | + | |
− | * [[ | + | == Genes associated with this reaction == |
− | * [[ | + | Genes have been associated with this reaction based on different elements listed below. |
− | * [[ | + | * Gene: [[Ec-02_006430]] |
+ | ** Source: [[annotation-esiliculosus_genome]] | ||
+ | *** Assignment: AUTOMATED-NAME-MATCH | ||
+ | * Gene: [[Ec-03_003710]] | ||
+ | ** Source: [[annotation-esiliculosus_genome]] | ||
+ | *** Assignment: AUTOMATED-NAME-MATCH | ||
+ | * Gene: [[Ec-12_008720]] | ||
+ | ** Source: [[annotation-esiliculosus_genome]] | ||
+ | *** Assignment: AUTOMATED-NAME-MATCH | ||
+ | * Gene: [[Ec-01_001560]] | ||
+ | ** Source: [[annotation-esiliculosus_genome]] | ||
+ | *** Assignment: AUTOMATED-NAME-MATCH | ||
+ | == Pathways == | ||
+ | * [[PWY66-387]], fatty acid α-oxidation II: [http://metacyc.org/META/NEW-IMAGE?object=PWY66-387 PWY66-387] | ||
+ | ** '''4''' reactions found over '''6''' reactions in the full pathway | ||
+ | == Reconstruction information == | ||
+ | * Category: [[annotation]] | ||
+ | ** Source: [[annotation-esiliculosus_genome]] | ||
+ | *** Tool: [[pathwaytools]] | ||
== External links == | == External links == | ||
− | + | {{#set: direction=LEFT-TO-RIGHT}} | |
− | + | {{#set: common name=3-methyl-branched fatty acyl-CoA ligase}} | |
− | + | {{#set: common name=long chain acyl-coA synthetase}} | |
− | + | {{#set: common name=long chain acyl-CoA synthetase}} | |
− | + | {{#set: ec number=EC-6.2.1.3}} | |
− | + | {{#set: gene associated=Ec-02_006430|Ec-03_003710|Ec-12_008720|Ec-01_001560}} | |
− | + | {{#set: in pathway=PWY66-387}} | |
− | + | {{#set: reconstruction category=annotation}} | |
− | + | {{#set: reconstruction source=annotation-esiliculosus_genome}} | |
− | + | {{#set: reconstruction tool=pathwaytools}} | |
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: common name= | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + |
Latest revision as of 19:33, 21 March 2018
Contents
Reaction RXN66-469
- direction:
- LEFT-TO-RIGHT
- common name:
- 3-methyl-branched fatty acyl-CoA ligase
- long chain acyl-coA synthetase
- long chain acyl-CoA synthetase
- ec number:
- Synonym(s):
Reaction Formula
- With identifiers:
- 1 CO-A[c] + 1 ATP[c] + 1 3-Methyl-Saturated-Fatty-Acids[c] => 1 AMP[c] + 1 PPI[c] + 1 3-Methyl-Saturated-Fatty-Acyl-CoA[c]
- With common name(s):
- 1 coenzyme A[c] + 1 ATP[c] + 1 a 3-methyl-branched 2,3,4-saturated fatty acid[c] => 1 AMP[c] + 1 diphosphate[c] + 1 a 3-methyl-branched 2,3,4-saturated fatty acyl-CoA[c]
Genes associated with this reaction
Genes have been associated with this reaction based on different elements listed below.
- Gene: Ec-02_006430
- Source: annotation-esiliculosus_genome
- Assignment: AUTOMATED-NAME-MATCH
- Source: annotation-esiliculosus_genome
- Gene: Ec-03_003710
- Source: annotation-esiliculosus_genome
- Assignment: AUTOMATED-NAME-MATCH
- Source: annotation-esiliculosus_genome
- Gene: Ec-12_008720
- Source: annotation-esiliculosus_genome
- Assignment: AUTOMATED-NAME-MATCH
- Source: annotation-esiliculosus_genome
- Gene: Ec-01_001560
- Source: annotation-esiliculosus_genome
- Assignment: AUTOMATED-NAME-MATCH
- Source: annotation-esiliculosus_genome
Pathways
- PWY66-387, fatty acid α-oxidation II: PWY66-387
- 4 reactions found over 6 reactions in the full pathway
Reconstruction information
- Category: annotation
- Source: annotation-esiliculosus_genome
- Tool: pathwaytools
- Source: annotation-esiliculosus_genome