Difference between revisions of "Ec-01 003640"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=MPBQ MPBQ] == * smiles: ** CC(CCCC(CCCC(C)CCCC(C)=CCC1(C=C(C=C(C)C=1O)O))C)C * inchi key: ** In...") |
(Created page with "Category:Gene == Gene Ec-01_003640 == * left end position: ** 3039440 * transcription direction: ** NEGATIVE * right end position: ** 3049763 * centisome position: ** 29.4...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Ec-01_003640 == |
− | * | + | * left end position: |
− | ** | + | ** 3039440 |
− | * | + | * transcription direction: |
− | ** | + | ** NEGATIVE |
− | * | + | * right end position: |
− | ** | + | ** 3049763 |
− | * | + | * centisome position: |
− | ** | + | ** 29.455265 |
* Synonym(s): | * Synonym(s): | ||
+ | ** Esi_0003_0287 | ||
+ | ** Esi0003_0287 | ||
+ | ** ARGRS | ||
− | == | + | == Reactions associated == |
− | * [[ | + | * Reaction: [[ARGININE--TRNA-LIGASE-RXN]] |
− | * [[ | + | ** Source: [[annotation-esiliculosus_genome]] |
− | == | + | *** Assignment: ec-number |
− | * [[ | + | == Pathways associated == |
− | + | * [[TRNA-CHARGING-PWY]] | |
== External links == | == External links == | ||
− | + | {{#set: left end position=3039440}} | |
− | + | {{#set: transcription direction=NEGATIVE}} | |
− | + | {{#set: right end position=3049763}} | |
− | + | {{#set: centisome position=29.455265 }} | |
− | + | {{#set: common name=Esi_0003_0287|Esi0003_0287|ARGRS}} | |
− | + | {{#set: reaction associated=ARGININE--TRNA-LIGASE-RXN}} | |
− | + | {{#set: pathway associated=TRNA-CHARGING-PWY}} | |
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + |
Latest revision as of 19:33, 21 March 2018
Gene Ec-01_003640
- left end position:
- 3039440
- transcription direction:
- NEGATIVE
- right end position:
- 3049763
- centisome position:
- 29.455265
- Synonym(s):
- Esi_0003_0287
- Esi0003_0287
- ARGRS
Reactions associated
- Reaction: ARGININE--TRNA-LIGASE-RXN
- Source: annotation-esiliculosus_genome
- Assignment: ec-number
- Source: annotation-esiliculosus_genome