Difference between revisions of "Ec-06 008380"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7105 CPD-7105] == * smiles: ** CC(=CCC1(=C(C(=C(C(=C1[O-])CC=C(C)C)O)C(CC(C)C)=O)O))C * inc...")
(Created page with "Category:Gene == Gene Ec-06_008380 == * Synonym(s): ** Esi_0175_0014 ** Esi0175_0014 == Reactions associated == * Reaction: ATP-CITRATE-PRO-S--LYASE-RXN ** Source: ...")
 
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Gene]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7105 CPD-7105] ==
+
== Gene Ec-06_008380 ==
* smiles:
+
** CC(=CCC1(=C(C(=C(C(=C1[O-])CC=C(C)C)O)C(CC(C)C)=O)O))C
+
* inchi key:
+
** InChIKey=NQYBQBZOHCACCR-UHFFFAOYSA-M
+
* common name:
+
** diprenylphlorisovalerophenone
+
* molecular weight:
+
** 345.458   
+
 
* Synonym(s):
 
* Synonym(s):
** deoxyhumulone
+
** Esi_0175_0014
 +
** Esi0175_0014
  
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
== Reaction(s) known to produce the compound ==
+
* Reaction: [[ATP-CITRATE-PRO-S--LYASE-RXN]]
* [[RXN-7810]]
+
** Source: [[orthology-aragem]]
== Reaction(s) of unknown directionality ==
+
== Pathways associated ==
 +
* [[PWY-5172]]
 +
* [[P23-PWY]]
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
{{#set: common name=Esi_0175_0014|Esi0175_0014}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25203000 25203000]
+
{{#set: reaction associated=ATP-CITRATE-PRO-S--LYASE-RXN}}
{{#set: smiles=CC(=CCC1(=C(C(=C(C(=C1[O-])CC=C(C)C)O)C(CC(C)C)=O)O))C}}
+
{{#set: pathway associated=PWY-5172|P23-PWY}}
{{#set: inchi key=InChIKey=NQYBQBZOHCACCR-UHFFFAOYSA-M}}
+
{{#set: common name=diprenylphlorisovalerophenone}}
+
{{#set: molecular weight=345.458    }}
+
{{#set: common name=deoxyhumulone}}
+
{{#set: produced by=RXN-7810}}
+

Latest revision as of 19:33, 21 March 2018

Gene Ec-06_008380

  • Synonym(s):
    • Esi_0175_0014
    • Esi0175_0014

Reactions associated

Pathways associated

External links