Difference between revisions of "Ec-06 008380"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7105 CPD-7105] == * smiles: ** CC(=CCC1(=C(C(=C(C(=C1[O-])CC=C(C)C)O)C(CC(C)C)=O)O))C * inc...") |
(Created page with "Category:Gene == Gene Ec-06_008380 == * Synonym(s): ** Esi_0175_0014 ** Esi0175_0014 == Reactions associated == * Reaction: ATP-CITRATE-PRO-S--LYASE-RXN ** Source: ...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Ec-06_008380 == |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** Esi_0175_0014 |
+ | ** Esi0175_0014 | ||
− | == | + | == Reactions associated == |
− | + | * Reaction: [[ATP-CITRATE-PRO-S--LYASE-RXN]] | |
− | * [[ | + | ** Source: [[orthology-aragem]] |
− | == | + | == Pathways associated == |
+ | * [[PWY-5172]] | ||
+ | * [[P23-PWY]] | ||
== External links == | == External links == | ||
− | + | {{#set: common name=Esi_0175_0014|Esi0175_0014}} | |
− | + | {{#set: reaction associated=ATP-CITRATE-PRO-S--LYASE-RXN}} | |
− | {{#set: | + | {{#set: pathway associated=PWY-5172|P23-PWY}} |
− | {{#set: | + | |
− | {{#set: | + | |
− | + | ||
− | + | ||
− | + |
Latest revision as of 20:33, 21 March 2018
Gene Ec-06_008380
- Synonym(s):
- Esi_0175_0014
- Esi0175_0014
Reactions associated
- Reaction: ATP-CITRATE-PRO-S--LYASE-RXN
- Source: orthology-aragem