Difference between revisions of "3.1.1.64-RXN"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DI-H-OROTATE DI-H-OROTATE] == * smiles: ** C1(C(=O)NC(=O)NC(C(=O)[O-])1) * inchi key: ** InChIK...") |
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=3.1.1.64-RXN 3.1.1.64-RXN] == * direction: ** LEFT-TO-RIGHT * common name: ** all-trans-retinyl-pal...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Reaction]] |
− | == | + | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=3.1.1.64-RXN 3.1.1.64-RXN] == |
− | * | + | * direction: |
− | ** | + | ** LEFT-TO-RIGHT |
− | + | ||
− | + | ||
* common name: | * common name: | ||
− | ** | + | ** all-trans-retinyl-palmitate hydrolase |
− | * | + | ** Phospholipase/carboxylesterase/thioesterase |
− | ** | + | ** carboxylic ester hydrolase |
+ | ** Carboxylesterase, type B | ||
+ | ** putative serine esterase | ||
+ | * ec number: | ||
+ | ** [http://enzyme.expasy.org/EC/3.1.1.1 EC-3.1.1.1] | ||
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | == Reaction(s) | + | == Reaction Formula == |
− | * [[ | + | * With identifiers: |
− | * [[ | + | ** 1 [[WATER]][c] '''+''' 1 [[CHOCOLA_A]][c] '''=>''' 1 [[PROTON]][c] '''+''' 1 [[CPD-13524]][c] '''+''' 1 [[PALMITATE]][c] |
− | * [[ | + | * With common name(s): |
− | + | ** 1 H2O[c] '''+''' 1 all-trans-retinyl palmitate[c] '''=>''' 1 H+[c] '''+''' 1 all-trans-retinol[c] '''+''' 1 palmitate[c] | |
− | * [[ | + | |
− | == | + | == Genes associated with this reaction == |
− | * [[ | + | Genes have been associated with this reaction based on different elements listed below. |
+ | * Gene: [[Ec-19_001900]] | ||
+ | ** Source: [[annotation-esiliculosus_genome]] | ||
+ | *** Assignment: GO-TERM | ||
+ | * Gene: [[Ec-27_004830]] | ||
+ | ** Source: [[annotation-esiliculosus_genome]] | ||
+ | *** Assignment: AUTOMATED-NAME-MATCH | ||
+ | * Gene: [[Ec-12_006850]] | ||
+ | ** Source: [[annotation-esiliculosus_genome]] | ||
+ | *** Assignment: AUTOMATED-NAME-MATCH | ||
+ | * Gene: [[Ec-25_000250]] | ||
+ | ** Source: [[annotation-esiliculosus_genome]] | ||
+ | *** Assignment: GO-TERM | ||
+ | * Gene: [[Ec-16_002070]] | ||
+ | ** Source: [[annotation-esiliculosus_genome]] | ||
+ | *** Assignment: AUTOMATED-NAME-MATCH | ||
+ | == Pathways == | ||
+ | == Reconstruction information == | ||
+ | * Category: [[annotation]] | ||
+ | ** Source: [[annotation-esiliculosus_genome]] | ||
+ | *** Tool: [[pathwaytools]] | ||
== External links == | == External links == | ||
− | * | + | * RHEA: |
− | + | ** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=13933 13933] | |
− | + | * LIGAND-RXN: | |
− | + | ** [http://www.genome.jp/dbget-bin/www_bget?R02368 R02368] | |
− | ** [http:// | + | {{#set: direction=LEFT-TO-RIGHT}} |
− | + | {{#set: common name=all-trans-retinyl-palmitate hydrolase}} | |
− | * LIGAND- | + | {{#set: common name=Phospholipase/carboxylesterase/thioesterase}} |
− | ** [http://www.genome.jp/dbget-bin/www_bget? | + | {{#set: common name=carboxylic ester hydrolase}} |
− | + | {{#set: common name=Carboxylesterase, type B}} | |
− | + | {{#set: common name=putative serine esterase}} | |
− | + | {{#set: ec number=EC-3.1.1.1}} | |
− | + | {{#set: gene associated=Ec-19_001900|Ec-27_004830|Ec-12_006850|Ec-25_000250|Ec-16_002070}} | |
− | + | {{#set: in pathway=}} | |
− | {{#set: | + | {{#set: reconstruction category=annotation}} |
− | {{#set: | + | {{#set: reconstruction source=annotation-esiliculosus_genome}} |
− | {{#set: common name= | + | {{#set: reconstruction tool=pathwaytools}} |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + |
Latest revision as of 19:34, 21 March 2018
Contents
Reaction 3.1.1.64-RXN
- direction:
- LEFT-TO-RIGHT
- common name:
- all-trans-retinyl-palmitate hydrolase
- Phospholipase/carboxylesterase/thioesterase
- carboxylic ester hydrolase
- Carboxylesterase, type B
- putative serine esterase
- ec number:
- Synonym(s):
Reaction Formula
- With identifiers:
- With common name(s):
- 1 H2O[c] + 1 all-trans-retinyl palmitate[c] => 1 H+[c] + 1 all-trans-retinol[c] + 1 palmitate[c]
Genes associated with this reaction
Genes have been associated with this reaction based on different elements listed below.
- Gene: Ec-19_001900
- Source: annotation-esiliculosus_genome
- Assignment: GO-TERM
- Source: annotation-esiliculosus_genome
- Gene: Ec-27_004830
- Source: annotation-esiliculosus_genome
- Assignment: AUTOMATED-NAME-MATCH
- Source: annotation-esiliculosus_genome
- Gene: Ec-12_006850
- Source: annotation-esiliculosus_genome
- Assignment: AUTOMATED-NAME-MATCH
- Source: annotation-esiliculosus_genome
- Gene: Ec-25_000250
- Source: annotation-esiliculosus_genome
- Assignment: GO-TERM
- Source: annotation-esiliculosus_genome
- Gene: Ec-16_002070
- Source: annotation-esiliculosus_genome
- Assignment: AUTOMATED-NAME-MATCH
- Source: annotation-esiliculosus_genome
Pathways
Reconstruction information
- Category: annotation
- Source: annotation-esiliculosus_genome
- Tool: pathwaytools
- Source: annotation-esiliculosus_genome
External links