Difference between revisions of "L-PANTOATE"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=FPPSYN-RXN FPPSYN-RXN] == * direction: ** LEFT-TO-RIGHT * common name: ** Prenyltransferase/squalen...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=L-PANTOATE L-PANTOATE] == * smiles: ** CC(C)(CO)C(C([O-])=O)O * inchi key: ** InChIKey=OTOIIPJY...")
 
Line 1: Line 1:
−
[[Category:Reaction]]
+
[[Category:Metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=FPPSYN-RXN FPPSYN-RXN] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=L-PANTOATE L-PANTOATE] ==
−
* direction:
+
* smiles:
−
** LEFT-TO-RIGHT
+
** CC(C)(CO)C(C([O-])=O)O
 +
* inchi key:
 +
** InChIKey=OTOIIPJYVQJATP-BYPYZUCNSA-M
 
* common name:
 
* common name:
−
** Prenyltransferase/squalene oxidase
+
** (R)-pantoate
−
** Farnesyl pyrophosphate synthase
+
* molecular weight:
−
* ec number:
+
** 147.15   
−
** [http://enzyme.expasy.org/EC/2.5.1.10 EC-2.5.1.10]
+
 
* Synonym(s):
 
* Synonym(s):
 +
** pantoate
 +
** L-pantoate
  
−
== Reaction Formula ==
+
== Reaction(s) known to consume the compound ==
−
* With identifiers:
+
* [[PANTOATE-BETA-ALANINE-LIG-RXN]]
−
** 1 [[DELTA3-ISOPENTENYL-PP]][c] '''+''' 1 [[GERANYL-PP]][c] '''=>''' 1 [[PPI]][c] '''+''' 1 [[FARNESYL-PP]][c]
+
== Reaction(s) known to produce the compound ==
−
* With common name(s):
+
* [[2-DEHYDROPANTOATE-REDUCT-RXN]]
−
** 1 isopentenyl diphosphate[c] '''+''' 1 geranyl diphosphate[c] '''=>''' 1 diphosphate[c] '''+''' 1 (2E,6E)-farnesyl diphosphate[c]
+
== Reaction(s) of unknown directionality ==
−
 
+
−
== Genes associated with this reaction  ==
+
−
Genes have been associated with this reaction based on different elements listed below.
+
−
* Gene: [[Ec-10_003020]]
+
−
** Source: [[annotation-esiliculosus_genome]]
+
−
*** Assignment: EC-NUMBER
+
−
* Gene: [[Ec-07_006170]]
+
−
** Source: [[annotation-esiliculosus_genome]]
+
−
*** Assignment: AUTOMATED-NAME-MATCH
+
−
* Gene: [[Ec-16_004330]]
+
−
** Source: [[orthology-aragem]]
+
−
== Pathways  ==
+
−
* [[PWY-7721]], methyl phomopsenoate biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY-7721 PWY-7721]
+
−
** '''2''' reactions found over '''4''' reactions in the full pathway
+
−
* [[PWY-7736]], stellatic acid biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY-7736 PWY-7736]
+
−
** '''3''' reactions found over '''8''' reactions in the full pathway
+
−
* [[PWY-5123]], trans, trans-farnesyl diphosphate biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY-5123 PWY-5123]
+
−
** '''3''' reactions found over '''3''' reactions in the full pathway
+
−
* [[PWY-6859]], all-trans-farnesol biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY-6859 PWY-6859]
+
−
** '''3''' reactions found over '''4''' reactions in the full pathway
+
−
* [[PWY-7102]], bisabolene biosynthesis (engineered): [http://metacyc.org/META/NEW-IMAGE?object=PWY-7102 PWY-7102]
+
−
** '''3''' reactions found over '''6''' reactions in the full pathway
+
−
== Reconstruction information  ==
+
−
* Category: [[orthology]]
+
−
** Source: [[orthology-aragem]]
+
−
*** Tool: [[pantograph]]
+
−
* Category: [[annotation]]
+
−
** Source: [[annotation-esiliculosus_genome]]
+
−
*** Tool: [[pathwaytools]]
+
 
== External links  ==
 
== External links  ==
−
* RHEA:
+
* CAS : 470-29-1
−
** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=19361 19361]
+
* DRUGBANK : DB01930
−
* LIGAND-RXN:
+
* PUBCHEM:
−
** [http://www.genome.jp/dbget-bin/www_bget?R02003 R02003]
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=5289105 5289105]
−
* UNIPROT:
+
* LIGAND-CPD:
−
** [http://www.uniprot.org/uniprot/P08524 P08524]
+
** [http://www.genome.jp/dbget-bin/www_bget?C00522 C00522]
−
** [http://www.uniprot.org/uniprot/P05369 P05369]
+
* CHEMSPIDER:
−
** [http://www.uniprot.org/uniprot/P14324 P14324]
+
** [http://www.chemspider.com/Chemical-Structure.4451134.html 4451134]
−
** [http://www.uniprot.org/uniprot/Q9CH81 Q9CH81]
+
* CHEBI:
−
** [http://www.uniprot.org/uniprot/Q9PM32 Q9PM32]
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=15980 15980]
−
** [http://www.uniprot.org/uniprot/P45204 P45204]
+
* BIGG : 35240
−
** [http://www.uniprot.org/uniprot/Q9JSM0 Q9JSM0]
+
{{#set: smiles=CC(C)(CO)C(C([O-])=O)O}}
−
** [http://www.uniprot.org/uniprot/P49350 P49350]
+
{{#set: inchi key=InChIKey=OTOIIPJYVQJATP-BYPYZUCNSA-M}}
−
** [http://www.uniprot.org/uniprot/P22939 P22939]
+
{{#set: common name=(R)-pantoate}}
−
** [http://www.uniprot.org/uniprot/Q08291 Q08291]
+
{{#set: molecular weight=147.15    }}
−
** [http://www.uniprot.org/uniprot/P49349 P49349]
+
{{#set: common name=pantoate|L-pantoate}}
−
** [http://www.uniprot.org/uniprot/Q09152 Q09152]
+
{{#set: consumed by=PANTOATE-BETA-ALANINE-LIG-RXN}}
−
** [http://www.uniprot.org/uniprot/P49351 P49351]
+
{{#set: produced by=2-DEHYDROPANTOATE-REDUCT-RXN}}
−
** [http://www.uniprot.org/uniprot/P49352 P49352]
+
−
** [http://www.uniprot.org/uniprot/Q43315 Q43315]
+
−
** [http://www.uniprot.org/uniprot/O24241 O24241]
+
−
** [http://www.uniprot.org/uniprot/O24242 O24242]
+
−
** [http://www.uniprot.org/uniprot/Q92334 Q92334]
+
−
** [http://www.uniprot.org/uniprot/Q92218 Q92218]
+
−
** [http://www.uniprot.org/uniprot/Q92235 Q92235]
+
−
** [http://www.uniprot.org/uniprot/Q92250 Q92250]
+
−
** [http://www.uniprot.org/uniprot/Q8L7F4 Q8L7F4]
+
−
** [http://www.uniprot.org/uniprot/P49353 P49353]
+
−
** [http://www.uniprot.org/uniprot/O04882 O04882]
+
−
** [http://www.uniprot.org/uniprot/O65004 O65004]
+
−
** [http://www.uniprot.org/uniprot/O14230 O14230]
+
−
{{#set: direction=LEFT-TO-RIGHT}}
+
−
{{#set: common name=Prenyltransferase/squalene oxidase}}
+
−
{{#set: common name=Farnesyl pyrophosphate synthase}}
+
−
{{#set: ec number=EC-2.5.1.10}}
+
−
{{#set: gene associated=Ec-10_003020|Ec-07_006170|Ec-16_004330}}
+
−
{{#set: in pathway=PWY-7721|PWY-7736|PWY-5123|PWY-6859|PWY-7102}}
+
−
{{#set: reconstruction category=orthology|annotation}}
+
−
{{#set: reconstruction source=annotation-esiliculosus_genome|orthology-aragem}}
+
−
{{#set: reconstruction tool=pantograph|pathwaytools}}
+

Latest revision as of 19:34, 21 March 2018

Metabolite L-PANTOATE

  • smiles:
    • CC(C)(CO)C(C([O-])=O)O
  • inchi key:
    • InChIKey=OTOIIPJYVQJATP-BYPYZUCNSA-M
  • common name:
    • (R)-pantoate
  • molecular weight:
    • 147.15
  • Synonym(s):
    • pantoate
    • L-pantoate

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"CC(C)(CO)C(C([O-])=O)O" cannot be used as a page name in this wiki.




Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=L-PANTOATE&oldid=27808"