Difference between revisions of "Ec-14 000810"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-17347 CPD-17347] == * smiles: ** CCCCCC=CCC=CCCCCCCCC(O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)C...")
(Created page with "Category:Gene == Gene Ec-14_000810 == * left end position: ** 767461 * transcription direction: ** POSITIVE * right end position: ** 770315 * centisome position: ** 11.698...")
 
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-17347 CPD-17347] ==
+
== Gene Ec-14_000810 ==
−
* smiles:
+
* left end position:
−
** CCCCCC=CCC=CCCCCCCCC(O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
+
** 767461
−
* common name:
+
* transcription direction:
−
** (3R)-hydroxy-(11Z,14Z)-icosa-11,14-dienoyl-CoA
+
** POSITIVE
−
* inchi key:
+
* right end position:
−
** InChIKey=MNTSLNSVZACNCX-JPDDAYGWSA-J
+
** 770315
−
* molecular weight:
+
* centisome position:
−
** 1069.99    
+
** 11.698338    
 
* Synonym(s):
 
* Synonym(s):
−
** (3R)-hydroxy-20:2Δ11,14
+
** Esi_0029_0128
 +
** Esi0029_0128
 +
** NADSYN
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
* [[RXN-16096]]
+
* Reaction: [[NAD-SYNTH-GLN-RXN]]
−
== Reaction(s) known to produce the compound ==
+
** Source: [[annotation-esiliculosus_genome]]
−
* [[RXN-16095]]
+
*** Assignment: ec-number
−
== Reaction(s) of unknown directionality ==
+
** Source: [[orthology-aragem]]
 +
== Pathways associated ==
 +
* [[PYRIDNUCSAL-PWY]]
 +
* [[PWY-5653]]
 +
* [[PYRIDNUCSYN-PWY]]
 +
* [[PWY-5381]]
 +
* [[PWY-7761]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: left end position=767461}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=72193805 72193805]
+
{{#set: transcription direction=POSITIVE}}
−
* CHEBI:
+
{{#set: right end position=770315}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=76408 76408]
+
{{#set: centisome position=11.698338   }}
−
{{#set: smiles=CCCCCC=CCC=CCCCCCCCC(O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]}}
+
{{#set: common name=Esi_0029_0128|Esi0029_0128|NADSYN}}
−
{{#set: common name=(3R)-hydroxy-(11Z,14Z)-icosa-11,14-dienoyl-CoA}}
+
{{#set: reaction associated=NAD-SYNTH-GLN-RXN}}
−
{{#set: inchi key=InChIKey=MNTSLNSVZACNCX-JPDDAYGWSA-J}}
+
{{#set: pathway associated=PYRIDNUCSAL-PWY|PWY-5653|PYRIDNUCSYN-PWY|PWY-5381|PWY-7761}}
−
{{#set: molecular weight=1069.99   }}
+
−
{{#set: common name=(3R)-hydroxy-20:2Δ11,14}}
+
−
{{#set: consumed by=RXN-16096}}
+
−
{{#set: produced by=RXN-16095}}
+

Latest revision as of 19:34, 21 March 2018

Gene Ec-14_000810

  • left end position:
    • 767461
  • transcription direction:
    • POSITIVE
  • right end position:
    • 770315
  • centisome position:
    • 11.698338
  • Synonym(s):
    • Esi_0029_0128
    • Esi0029_0128
    • NADSYN

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=Ec-14_000810&oldid=27828"