Difference between revisions of "Ec-11 003320"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CIS-ACONITATE CIS-ACONITATE] == * smiles: ** C([O-])(=O)C(=CC(=O)[O-])CC(=O)[O-] * inchi key: *...") |
(Created page with "Category:Gene == Gene Ec-11_003320 == * left end position: ** 3403478 * transcription direction: ** NEGATIVE * right end position: ** 3412760 * centisome position: ** 54.1...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Ec-11_003320 == |
− | * | + | * left end position: |
− | ** | + | ** 3403478 |
− | * | + | * transcription direction: |
− | ** | + | ** NEGATIVE |
− | * | + | * right end position: |
− | ** | + | ** 3412760 |
− | * | + | * centisome position: |
− | ** | + | ** 54.11229 |
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** Esi_0048_0128 |
− | ** | + | ** Esi0048_0128 |
− | == | + | == Reactions associated == |
− | + | * Reaction: [[POLYNUCLEOTIDE-ADENYLYLTRANSFERASE-RXN]] | |
− | + | ** Source: [[annotation-esiliculosus_genome]] | |
− | * [[ | + | *** Assignment: automated-name-match |
− | * [[ | + | == Pathways associated == |
== External links == | == External links == | ||
− | + | {{#set: left end position=3403478}} | |
− | + | {{#set: transcription direction=NEGATIVE}} | |
− | + | {{#set: right end position=3412760}} | |
− | + | {{#set: centisome position=54.11229 }} | |
− | + | {{#set: common name=Esi_0048_0128|Esi0048_0128}} | |
− | + | {{#set: reaction associated=POLYNUCLEOTIDE-ADENYLYLTRANSFERASE-RXN}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: common name= | + | |
− | {{#set: | + |
Latest revision as of 19:35, 21 March 2018
Gene Ec-11_003320
- left end position:
- 3403478
- transcription direction:
- NEGATIVE
- right end position:
- 3412760
- centisome position:
- 54.11229
- Synonym(s):
- Esi_0048_0128
- Esi0048_0128
Reactions associated
- Reaction: POLYNUCLEOTIDE-ADENYLYLTRANSFERASE-RXN
- Source: annotation-esiliculosus_genome
- Assignment: automated-name-match
- Source: annotation-esiliculosus_genome