Difference between revisions of "4-TRIMETHYLAMMONIOBUTANAL"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=GMP-SYN-NH3-RXN GMP-SYN-NH3-RXN] == * direction: ** LEFT-TO-RIGHT * common name: ** GMP synthase (g...")
 
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7006 CPD-7006] == * smiles: ** C=CC2(C(C)=C4(C=C9(C(C)C(CCC(=O)OCC=C(C)CCCC(C)CCCC(C)CCC=C(...")
Line 1: Line 1:
[[Category:Reaction]]
+
[[Category:Metabolite]]
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=GMP-SYN-NH3-RXN GMP-SYN-NH3-RXN] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7006 CPD-7006] ==
* direction:
+
* smiles:
** LEFT-TO-RIGHT
+
** C=CC2(C(C)=C4(C=C9(C(C)C(CCC(=O)OCC=C(C)CCCC(C)CCCC(C)CCC=C(C)C)C5(=[N+]([Mg--]36([N+]1(=C(C(CC)=C(C)C1=CC=2N34)C=C7(C(C)=C8(C(=O)[C-](C(OC)=O)C5=C(N67)8)))))9))))
 +
* inchi key:
 +
** InChIKey=NVDIDZKEPDPXJJ-ONWAGYJKSA-M
 
* common name:
 
* common name:
** GMP synthase (glutamine-hydrolyzing)
+
** tetrahydrogeranylgeranyl chlorophyll a
 +
* molecular weight:
 +
** 890.479   
 
* Synonym(s):
 
* Synonym(s):
 +
** tetrahydroGG-chlorophyll a
 +
** tetrahydroGG-chl a
 +
** tetrahydrogeranylgeranyl-chl a
  
== Reaction Formula ==
+
== Reaction(s) known to consume the compound ==
* With identifiers:
+
* [[RXN-7666]]
** 1 [[ATP]][c] '''+''' 1 [[AMMONIUM]][c] '''+''' 1 [[XANTHOSINE-5-PHOSPHATE]][c] '''=>''' 1 [[GMP]][c] '''+''' 1 [[PPI]][c] '''+''' 2 [[PROTON]][c] '''+''' 1 [[AMP]][c]
+
== Reaction(s) known to produce the compound ==
* With common name(s):
+
* [[RXN-7665]]
** 1 ATP[c] '''+''' 1 ammonium[c] '''+''' 1 XMP[c] '''=>''' 1 GMP[c] '''+''' 1 diphosphate[c] '''+''' 2 H+[c] '''+''' 1 AMP[c]
+
== Reaction(s) of unknown directionality ==
 
+
== Genes associated with this reaction  ==
+
Genes have been associated with this reaction based on different elements listed below.
+
* [[Ec-13_002710]]
+
** ESILICULOSUS_GENOME
+
***EC-NUMBER
+
** [[pantograph]]-[[aragem]]
+
== Pathways  ==
+
== Reconstruction information  ==
+
* [[orthology]]:
+
** [[pantograph]]:
+
*** [[aragem]]
+
* [[annotation]]:
+
** [[pathwaytools]]:
+
*** [[esiliculosus_genome]]
+
 
== External links  ==
 
== External links  ==
* RHEA:
+
* PUBCHEM:
** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=18301 18301]
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=46926313 46926313]
* LIGAND-RXN:
+
{{#set: smiles=C=CC2(C(C)=C4(C=C9(C(C)C(CCC(=O)OCC=C(C)CCCC(C)CCCC(C)CCC=C(C)C)C5(=[N+]([Mg--]36([N+]1(=C(C(CC)=C(C)C1=CC=2N34)C=C7(C(C)=C8(C(=O)[C-](C(OC)=O)C5=C(N67)8)))))9))))}}
** [http://www.genome.jp/dbget-bin/www_bget?R01230 R01230]
+
{{#set: inchi key=InChIKey=NVDIDZKEPDPXJJ-ONWAGYJKSA-M}}
{{#set: direction=LEFT-TO-RIGHT}}
+
{{#set: common name=tetrahydrogeranylgeranyl chlorophyll a}}
{{#set: common name=GMP synthase (glutamine-hydrolyzing)}}
+
{{#set: molecular weight=890.479    }}
{{#set: gene associated=Ec-13_002710}}
+
{{#set: common name=tetrahydroGG-chlorophyll a|tetrahydroGG-chl a|tetrahydrogeranylgeranyl-chl a}}
{{#set: in pathway=}}
+
{{#set: consumed by=RXN-7666}}
{{#set: reconstruction category=orthology}}
+
{{#set: produced by=RXN-7665}}
{{#set: reconstruction tool=pantograph}}
+
{{#set: reconstruction source=aragem}}
+
{{#set: reconstruction category=annotation}}
+
{{#set: reconstruction tool=pathwaytools}}
+
{{#set: reconstruction source=esiliculosus_genome}}
+

Revision as of 20:51, 17 March 2018

Metabolite CPD-7006

  • smiles:
    • C=CC2(C(C)=C4(C=C9(C(C)C(CCC(=O)OCC=C(C)CCCC(C)CCCC(C)CCC=C(C)C)C5(=[N+]([Mg--]36([N+]1(=C(C(CC)=C(C)C1=CC=2N34)C=C7(C(C)=C8(C(=O)[C-](C(OC)=O)C5=C(N67)8)))))9))))
  • inchi key:
    • InChIKey=NVDIDZKEPDPXJJ-ONWAGYJKSA-M
  • common name:
    • tetrahydrogeranylgeranyl chlorophyll a
  • molecular weight:
    • 890.479
  • Synonym(s):
    • tetrahydroGG-chlorophyll a
    • tetrahydroGG-chl a
    • tetrahydrogeranylgeranyl-chl a

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"C=CC2(C(C)=C4(C=C9(C(C)C(CCC(=O)OCC=C(C)CCCC(C)CCCC(C)CCC=C(C)C)C5(=[N+]([Mg--]36([N+]1(=C(C(CC)=C(C)C1=CC=2N34)C=C7(C(C)=C8(C(=O)[C-](C(OC)=O)C5=C(N67)8)))))9))))" cannot be used as a page name in this wiki.