Difference between revisions of "GALACTOSE"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN0-747 RXN0-747] == * direction: ** LEFT-TO-RIGHT * common name: ** ribonucleoside-diphosphate re...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=GALACTOSE GALACTOSE] == * smiles: ** C(O)C1(OC(O)C(O)C(O)C(O)1) * inchi key: ** InChIKey=WQZGKK...")
 
Line 1: Line 1:
[[Category:Reaction]]
+
[[Category:Metabolite]]
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN0-747 RXN0-747] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=GALACTOSE GALACTOSE] ==
* direction:
+
* smiles:
** LEFT-TO-RIGHT
+
** C(O)C1(OC(O)C(O)C(O)C(O)1)
 +
* inchi key:
 +
** InChIKey=WQZGKKKJIJFFOK-FPRJBGLDSA-N
 
* common name:
 
* common name:
** ribonucleoside-diphosphate reductase activity, thioredoxin disulfide as acceptor
+
** β-D-galactose
** EsV-1-128
+
* molecular weight:
** EsV-1-180
+
** 180.157   
** Ribonucleoside-diphosphate reductase small chain
+
* ec number:
+
** [http://enzyme.expasy.org/EC/1.17.4.1 EC-1.17.4.1]
+
 
* Synonym(s):
 
* Synonym(s):
 +
** β-D-galactopyranose
 +
** cerebrose
 +
** 6-(hydroxymethyl)tetrahydropyran-2,3,4,5-tetraol
  
== Reaction Formula ==
+
== Reaction(s) known to consume the compound ==
* With identifiers:
+
== Reaction(s) known to produce the compound ==
** 1 [[ADP]][c] '''+''' 1 [[Reduced-NrdH-Proteins]][c] '''=>''' 1 [[WATER]][c] '''+''' 1 [[Oxidized-NrdH-Proteins]][c] '''+''' 1 [[DADP]][c]
+
* [[BETAGALACTOSID-RXN]]
* With common name(s):
+
== Reaction(s) of unknown directionality ==
** 1 ADP[c] '''+''' 1 a reduced NrdH glutaredoxin-like protein[c] '''=>''' 1 H2O[c] '''+''' 1 an oxidized NrdH glutaredoxin-like protein[c] '''+''' 1 dADP[c]
+
* [[ALDOSE1EPIM-RXN]]
 
+
== Genes associated with this reaction  ==
+
Genes have been associated with this reaction based on different elements listed below.
+
* Gene: [[Ec-06_005570]]
+
** Source: [[annotation-esiliculosus_genome]]
+
*** Assignment: EC-NUMBER
+
* Gene: [[Ec-19_000440]]
+
** Source: [[annotation-esiliculosus_genome]]
+
*** Assignment: EC-NUMBER
+
* Gene: [[Ec-11_002170]]
+
** Source: [[annotation-esiliculosus_genome]]
+
*** Assignment: GO-TERM
+
* Gene: [[Ec-06_005120]]
+
** Source: [[annotation-esiliculosus_genome]]
+
*** Assignment: EC-NUMBER
+
* Gene: [[Ec-21_002920]]
+
** Source: [[annotation-esiliculosus_genome]]
+
*** Assignment: GO-TERM
+
== Pathways  ==
+
* [[PWY-7220]], adenosine deoxyribonucleotides de novo biosynthesis II: [http://metacyc.org/META/NEW-IMAGE?object=PWY-7220 PWY-7220]
+
** '''4''' reactions found over '''4''' reactions in the full pathway
+
== Reconstruction information  ==
+
* Category: [[annotation]]
+
** Source: [[annotation-esiliculosus_genome]]
+
*** Tool: [[pathwaytools]]
+
 
== External links  ==
 
== External links  ==
{{#set: direction=LEFT-TO-RIGHT}}
+
* CAS : 7296-64-2
{{#set: common name=ribonucleoside-diphosphate reductase activity, thioredoxin disulfide as acceptor}}
+
* PUBCHEM:
{{#set: common name=EsV-1-128}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=439353 439353]
{{#set: common name=EsV-1-180}}
+
* HMDB : HMDB03449
{{#set: common name=Ribonucleoside-diphosphate reductase small chain}}
+
* LIGAND-CPD:
{{#set: ec number=EC-1.17.4.1}}
+
** [http://www.genome.jp/dbget-bin/www_bget?C00962 C00962]
{{#set: gene associated=Ec-06_005570|Ec-19_000440|Ec-11_002170|Ec-06_005120|Ec-21_002920}}
+
* CHEMSPIDER:
{{#set: in pathway=PWY-7220}}
+
** [http://www.chemspider.com/Chemical-Structure.388476.html 388476]
{{#set: reconstruction category=annotation}}
+
* CHEBI:
{{#set: reconstruction source=annotation-esiliculosus_genome}}
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=28034 28034]
{{#set: reconstruction tool=pathwaytools}}
+
* BIGG : 37923
 +
{{#set: smiles=C(O)C1(OC(O)C(O)C(O)C(O)1)}}
 +
{{#set: inchi key=InChIKey=WQZGKKKJIJFFOK-FPRJBGLDSA-N}}
 +
{{#set: common name=β-D-galactose}}
 +
{{#set: molecular weight=180.157    }}
 +
{{#set: common name=β-D-galactopyranose|cerebrose|6-(hydroxymethyl)tetrahydropyran-2,3,4,5-tetraol}}
 +
{{#set: produced by=BETAGALACTOSID-RXN}}
 +
{{#set: reversible reaction associated=ALDOSE1EPIM-RXN}}

Latest revision as of 19:36, 21 March 2018

Metabolite GALACTOSE

  • smiles:
    • C(O)C1(OC(O)C(O)C(O)C(O)1)
  • inchi key:
    • InChIKey=WQZGKKKJIJFFOK-FPRJBGLDSA-N
  • common name:
    • β-D-galactose
  • molecular weight:
    • 180.157
  • Synonym(s):
    • β-D-galactopyranose
    • cerebrose
    • 6-(hydroxymethyl)tetrahydropyran-2,3,4,5-tetraol

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

  • CAS : 7296-64-2
  • PUBCHEM:
  • HMDB : HMDB03449
  • LIGAND-CPD:
  • CHEMSPIDER:
  • CHEBI:
  • BIGG : 37923