Difference between revisions of "Ec-14 005100"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=N-FORMYLKYNURENINE N-FORMYLKYNURENINE] == * smiles: ** [CH](=O)NC1(C=CC=CC=1C(=O)CC([N+])C(=O)[...")
(Created page with "Category:Gene == Gene Ec-14_005100 == * left end position: ** 4729668 * transcription direction: ** NEGATIVE * right end position: ** 4738997 * centisome position: ** 72.0...")
 
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=N-FORMYLKYNURENINE N-FORMYLKYNURENINE] ==
+
== Gene Ec-14_005100 ==
−
* smiles:
+
* left end position:
−
** [CH](=O)NC1(C=CC=CC=1C(=O)CC([N+])C(=O)[O-])
+
** 4729668
−
* inchi key:
+
* transcription direction:
−
** InChIKey=BYHJHXPTQMMKCA-QMMMGPOBSA-N
+
** NEGATIVE
−
* common name:
+
* right end position:
−
** N-formylkynurenine
+
** 4738997
−
* molecular weight:
+
* centisome position:
−
** 236.227    
+
** 72.093895    
 
* Synonym(s):
 
* Synonym(s):
−
** N-Formyl-L-kynurenine
+
** Esi_0399_0022
 +
** Esi0399_0022
 +
** PCS
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
== Reaction(s) known to produce the compound ==
+
* Reaction: [[2.3.2.15-RXN]]
−
* [[RXN-8665]]
+
** Source: [[annotation-esiliculosus_genome]]
−
== Reaction(s) of unknown directionality ==
+
*** Assignment: ec-number
 +
== Pathways associated ==
 +
* [[PWY-6745]]
 
== External links  ==
 
== External links  ==
−
* CAS : 1022-31-7
+
{{#set: left end position=4729668}}
−
* PUBCHEM:
+
{{#set: transcription direction=NEGATIVE}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25202092 25202092]
+
{{#set: right end position=4738997}}
−
* CHEBI:
+
{{#set: centisome position=72.093895   }}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58629 58629]
+
{{#set: common name=Esi_0399_0022|Esi0399_0022|PCS}}
−
* LIGAND-CPD:
+
{{#set: reaction associated=2.3.2.15-RXN}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C02700 C02700]
+
{{#set: pathway associated=PWY-6745}}
−
* HMDB : HMDB60485
+
−
{{#set: smiles=[CH](=O)NC1(C=CC=CC=1C(=O)CC([N+])C(=O)[O-])}}
+
−
{{#set: inchi key=InChIKey=BYHJHXPTQMMKCA-QMMMGPOBSA-N}}
+
−
{{#set: common name=N-formylkynurenine}}
+
−
{{#set: molecular weight=236.227   }}
+
−
{{#set: common name=N-Formyl-L-kynurenine}}
+
−
{{#set: produced by=RXN-8665}}
+

Latest revision as of 19:37, 21 March 2018

Gene Ec-14_005100

  • left end position:
    • 4729668
  • transcription direction:
    • NEGATIVE
  • right end position:
    • 4738997
  • centisome position:
    • 72.093895
  • Synonym(s):
    • Esi_0399_0022
    • Esi0399_0022
    • PCS

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=Ec-14_005100&oldid=28179"