Difference between revisions of "CPD1G-1344"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=SCOPOLETIN SCOPOLETIN] == * smiles: ** COC2(C=C1(C(OC(=O)C=C1)=CC=2O)) * inchi key: ** InChIKey...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD1G-1344 CPD1G-1344] == * smiles: ** CCCCCCCCCCCCCCCCCCCCCCCCCCC(C(O)CCCCCCCCCCCCCCCC2(CC(CCC...") |
||
| Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD1G-1344 CPD1G-1344] == |
* smiles: | * smiles: | ||
| − | ** | + | ** CCCCCCCCCCCCCCCCCCCCCCCCCCC(C(O)CCCCCCCCCCCCCCCC2(CC(CCCCCCCCCCC1(CC(CCCCCCCCCCCCCCCCCC)1))2))C(=O)OCC3(OC(C(C(C3O)O)O)OC4(C(C(C(C(O4)CO)O)O)O)) |
* inchi key: | * inchi key: | ||
| − | ** InChIKey= | + | ** InChIKey=HASPJLRXBAGTID-BGZCIIMLSA-N |
* common name: | * common name: | ||
| − | ** | + | ** trehalose-mono-mycolate |
* molecular weight: | * molecular weight: | ||
| − | ** | + | ** 1462.341 |
* Synonym(s): | * Synonym(s): | ||
| + | ** trehalose 6-monomycolate | ||
| + | ** α, α'-trehalose 6-mycolate | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[RXN1G-1435]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
| − | * | + | * LIPID_MAPS : LMFA01160001 |
| − | + | ||
* PUBCHEM: | * PUBCHEM: | ||
| − | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90658750 90658750] |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
* CHEBI: | * CHEBI: | ||
| − | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId= | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=18234 18234] |
| − | * | + | * LIGAND-CPD: |
| − | {{#set: smiles= | + | ** [http://www.genome.jp/dbget-bin/www_bget?C04218 C04218] |
| − | {{#set: inchi key=InChIKey= | + | {{#set: smiles=CCCCCCCCCCCCCCCCCCCCCCCCCCC(C(O)CCCCCCCCCCCCCCCC2(CC(CCCCCCCCCCC1(CC(CCCCCCCCCCCCCCCCCC)1))2))C(=O)OCC3(OC(C(C(C3O)O)O)OC4(C(C(C(C(O4)CO)O)O)O))}} |
| − | {{#set: common name= | + | {{#set: inchi key=InChIKey=HASPJLRXBAGTID-BGZCIIMLSA-N}} |
| − | {{#set: molecular weight= | + | {{#set: common name=trehalose-mono-mycolate}} |
| − | {{#set: produced by= | + | {{#set: molecular weight=1462.341 }} |
| + | {{#set: common name=trehalose 6-monomycolate|α, α'-trehalose 6-mycolate}} | ||
| + | {{#set: produced by=RXN1G-1435}} | ||
Latest revision as of 20:37, 21 March 2018
Contents
Metabolite CPD1G-1344
- smiles:
- CCCCCCCCCCCCCCCCCCCCCCCCCCC(C(O)CCCCCCCCCCCCCCCC2(CC(CCCCCCCCCCC1(CC(CCCCCCCCCCCCCCCCCC)1))2))C(=O)OCC3(OC(C(C(C3O)O)O)OC4(C(C(C(C(O4)CO)O)O)O))
- inchi key:
- InChIKey=HASPJLRXBAGTID-BGZCIIMLSA-N
- common name:
- trehalose-mono-mycolate
- molecular weight:
- 1462.341
- Synonym(s):
- trehalose 6-monomycolate
- α, α'-trehalose 6-mycolate
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
