Difference between revisions of "Ec-00 002670"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=D-GLUCARATE D-GLUCARATE] == * smiles: ** C(=O)(C(O)C(O)C(O)C(O)C(=O)[O-])[O-] * inchi key: ** I...") |
(Created page with "Category:Gene == Gene Ec-00_002670 == * left end position: ** 2858184 * transcription direction: ** POSITIVE * right end position: ** 2858473 * centisome position: ** 15.0...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Ec-00_002670 == |
− | * | + | * left end position: |
− | ** | + | ** 2858184 |
− | * | + | * transcription direction: |
− | ** | + | ** POSITIVE |
− | * | + | * right end position: |
− | ** | + | ** 2858473 |
− | * | + | * centisome position: |
− | ** | + | ** 15.085607 |
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** Esi_1595_0001 |
− | ** | + | ** Esi1595_0001 |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | == | + | == Reactions associated == |
− | + | * Reaction: [[RXN-1961]] | |
− | + | ** Source: [[annotation-esiliculosus_genome]] | |
− | * [[ | + | *** Assignment: automated-name-match |
+ | == Pathways associated == | ||
== External links == | == External links == | ||
− | + | {{#set: left end position=2858184}} | |
− | + | {{#set: transcription direction=POSITIVE}} | |
− | + | {{#set: right end position=2858473}} | |
− | + | {{#set: centisome position=15.085607 }} | |
− | + | {{#set: common name=Esi_1595_0001|Esi1595_0001}} | |
− | + | {{#set: reaction associated=RXN-1961}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: common name= | + | |
− | {{#set: | + |
Latest revision as of 19:37, 21 March 2018
Gene Ec-00_002670
- left end position:
- 2858184
- transcription direction:
- POSITIVE
- right end position:
- 2858473
- centisome position:
- 15.085607
- Synonym(s):
- Esi_1595_0001
- Esi1595_0001
Reactions associated
- Reaction: RXN-1961
- Source: annotation-esiliculosus_genome
- Assignment: automated-name-match
- Source: annotation-esiliculosus_genome