Difference between revisions of "5-Methylcytosine-DNA"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-17372 CPD-17372] == * smiles: ** C(O)CCCCCCCC=CCCCCCCCC(=O)OCC(COP([O-])([O-])=O)O * inchi...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=5-Methylcytosine-DNA 5-Methylcytosine-DNA] == * common name: ** a DNA 5-methylcytosine * Synony...") |
||
| Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=5-Methylcytosine-DNA 5-Methylcytosine-DNA] == |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
* common name: | * common name: | ||
| − | ** | + | ** a DNA 5-methylcytosine |
| − | + | ||
| − | + | ||
* Synonym(s): | * Synonym(s): | ||
| + | ** DNA containing 5-methylcytosine | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[DNA-CYTOSINE-5--METHYLTRANSFERASE-RXN]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
| − | + | {{#set: common name=a DNA 5-methylcytosine}} | |
| − | + | {{#set: common name=DNA containing 5-methylcytosine}} | |
| − | {{#set: | + | {{#set: produced by=DNA-CYTOSINE-5--METHYLTRANSFERASE-RXN}} |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | + | ||
| − | + | ||
| − | + | ||
Latest revision as of 19:38, 21 March 2018
Contents
Metabolite 5-Methylcytosine-DNA
- common name:
- a DNA 5-methylcytosine
- Synonym(s):
- DNA containing 5-methylcytosine
