Difference between revisions of "CHLOROPHYLLIDE-A"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CHLOROPHYLLIDE-A CHLOROPHYLLIDE-A] == * smiles: ** C=CC2(C(C)=C4(C=C9(C(C)C(CCC(=O)[O-])C5(=N([...")
 
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=B-KETOACYL-ACP B-KETOACYL-ACP] == * common name: ** a 3-oxoacyl-[acp] * Synonym(s): ** a beta-k...")
Line 1: Line 1:
 
[[Category:Metabolite]]
 
[[Category:Metabolite]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CHLOROPHYLLIDE-A CHLOROPHYLLIDE-A] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=B-KETOACYL-ACP B-KETOACYL-ACP] ==
−
* smiles:
+
−
** C=CC2(C(C)=C4(C=C9(C(C)C(CCC(=O)[O-])C5(=N([Mg]36(N1(=C(C(CC)=C(C)C1=CC=2N34)C=C7(C(C)=C8(C(=O)[C-](C(OC)=O)C5=C(N67)8)))))9))))
+
 
* common name:
 
* common name:
−
** chlorophyllide a
+
** a 3-oxoacyl-[acp]
−
* molecular weight:
+
−
** 612.967   
+
 
* Synonym(s):
 
* Synonym(s):
−
** chlorophyllide
+
** a beta-keto-acyl-acp
 +
** a 3-oxoacyl-[acyl-carrier protein]
 +
** acetoacyl-ACP
 +
** CH3(CH2)xCOCH2CO-S-ACP
 +
** a beta-keto-acyl-[acyl-carrier-protein]
 +
** a β-ketoacyl-[acp]
 +
** a 3-ketoacyl-[acp]
  
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
−
* [[RXN-7676]]
+
* [[3-OXOACYL-ACP-REDUCT-RXN]]
−
* [[RXN-13398]]
+
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[3-OXOACYL-ACP-SYNTH-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
−
* [[RXN1F-10]]
+
* [[2.3.1.41-RXN]]
 
== External links  ==
 
== External links  ==
−
* CAS : 14897-06-4
+
{{#set: common name=a 3-oxoacyl-[acp]}}
−
* PUBCHEM:
+
{{#set: common name=a beta-keto-acyl-acp|a 3-oxoacyl-[acyl-carrier protein]|acetoacyl-ACP|CH3(CH2)xCOCH2CO-S-ACP|a beta-keto-acyl-[acyl-carrier-protein]|a β-ketoacyl-[acp]|a 3-ketoacyl-[acp]}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=54729368 54729368]
+
{{#set: consumed by=3-OXOACYL-ACP-REDUCT-RXN}}
−
* CHEBI:
+
{{#set: produced by=3-OXOACYL-ACP-SYNTH-RXN}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=83348 83348]
+
{{#set: reversible reaction associated=2.3.1.41-RXN}}
−
* LIGAND-CPD:
+
−
** [http://www.genome.jp/dbget-bin/www_bget?C02139 C02139]
+
−
{{#set: smiles=C=CC2(C(C)=C4(C=C9(C(C)C(CCC(=O)[O-])C5(=N([Mg]36(N1(=C(C(CC)=C(C)C1=CC=2N34)C=C7(C(C)=C8(C(=O)[C-](C(OC)=O)C5=C(N67)8)))))9))))}}
+
−
{{#set: common name=chlorophyllide a}}
+
−
{{#set: molecular weight=612.967    }}
+
−
{{#set: common name=chlorophyllide}}
+
−
{{#set: consumed by=RXN-7676|RXN-13398}}
+
−
{{#set: consumed or produced by=RXN1F-10}}
+

Revision as of 20:52, 17 March 2018

Metabolite B-KETOACYL-ACP

  • common name:
    • a 3-oxoacyl-[acp]
  • Synonym(s):
    • a beta-keto-acyl-acp
    • a 3-oxoacyl-[acyl-carrier protein]
    • acetoacyl-ACP
    • CH3(CH2)xCOCH2CO-S-ACP
    • a beta-keto-acyl-[acyl-carrier-protein]
    • a β-ketoacyl-[acp]
    • a 3-ketoacyl-[acp]

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"a 3-oxoacyl-[acp" cannot be used as a page name in this wiki.
  • "a 3-oxoacyl-[acyl-carrier protein" cannot be used as a page name in this wiki.
  • "a beta-keto-acyl-[acyl-carrier-protein" cannot be used as a page name in this wiki.
  • "a β-ketoacyl-[acp" cannot be used as a page name in this wiki.
  • "a 3-ketoacyl-[acp" cannot be used as a page name in this wiki.


Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=CHLOROPHYLLIDE-A&oldid=10681"