Difference between revisions of "MG-PROTOPORPHYRIN-MONOMETHYL-ESTER"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Gene == Gene Ec-11_003940 == * left end position: ** 4016031 * transcription direction: ** POSITIVE * right end position: ** 4018562 * centisome position: ** 63.8...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=MG-PROTOPORPHYRIN-MONOMETHYL-ESTER MG-PROTOPORPHYRIN-MONOMETHYL-ESTER] == * smiles: ** C=CC2(C(...")
 
Line 1: Line 1:
[[Category:Gene]]
+
[[Category:Metabolite]]
== Gene Ec-11_003940 ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=MG-PROTOPORPHYRIN-MONOMETHYL-ESTER MG-PROTOPORPHYRIN-MONOMETHYL-ESTER] ==
* left end position:
+
* smiles:
** 4016031
+
** C=CC2(C(C)=C4(C=C8(C(C)=C(CCC(=O)[O-])C7(=N([Mg]35(N1(=C(C(C=C)=C(C)C1=CC=2N34)C=C6(C(C)=C(CCC(=O)OC)C(N56)=C7))))8))))
* transcription direction:
+
* common name:
** POSITIVE
+
** magnesium-protoporphyrin IX 13-monomethyl ester
* right end position:
+
* molecular weight:
** 4018562
+
** 597.975    
* centisome position:
+
** 63.851337    
+
 
* Synonym(s):
 
* Synonym(s):
** Esi_0192_0049
+
** Mg-protoporphyrin monomethyl ester
** Esi0192_0049
+
** magnesium protoporphyrin monomethyl ester
** PDI2
+
** MgPMME
 +
** magnesium-protoporphyrin IX 13-methyl ester
 +
** MgP monomethyl ester
  
== Reactions associated ==
+
== Reaction(s) known to consume the compound ==
* Reaction: [[5.3.4.1-RXN]]
+
== Reaction(s) known to produce the compound ==
** Source: [[annotation-esiliculosus_genome]]
+
* [[RXN-MG-PROTOPORPHYRIN-METHYLESTER-SYN]]
*** Assignment: automated-name-match
+
== Reaction(s) of unknown directionality ==
* Reaction: [[DISULISOM-RXN]]
+
** Source: [[annotation-esiliculosus_genome]]
+
*** Assignment: automated-name-match
+
== Pathways associated ==
+
 
== External links  ==
 
== External links  ==
{{#set: left end position=4016031}}
+
* PUBCHEM:
{{#set: transcription direction=POSITIVE}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90657954 90657954]
{{#set: right end position=4018562}}
+
* CHEBI:
{{#set: centisome position=63.851337   }}
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=60491 60491]
{{#set: common name=Esi_0192_0049|Esi0192_0049|PDI2}}
+
* LIGAND-CPD:
{{#set: reaction associated=5.3.4.1-RXN|DISULISOM-RXN}}
+
** [http://www.genome.jp/dbget-bin/www_bget?C04536 C04536]
 +
{{#set: smiles=C=CC2(C(C)=C4(C=C8(C(C)=C(CCC(=O)[O-])C7(=N([Mg]35(N1(=C(C(C=C)=C(C)C1=CC=2N34)C=C6(C(C)=C(CCC(=O)OC)C(N56)=C7))))8))))}}
 +
{{#set: common name=magnesium-protoporphyrin IX 13-monomethyl ester}}
 +
{{#set: molecular weight=597.975   }}
 +
{{#set: common name=Mg-protoporphyrin monomethyl ester|magnesium protoporphyrin monomethyl ester|MgPMME|magnesium-protoporphyrin IX 13-methyl ester|MgP monomethyl ester}}
 +
{{#set: produced by=RXN-MG-PROTOPORPHYRIN-METHYLESTER-SYN}}

Latest revision as of 19:38, 21 March 2018

Metabolite MG-PROTOPORPHYRIN-MONOMETHYL-ESTER

  • smiles:
    • C=CC2(C(C)=C4(C=C8(C(C)=C(CCC(=O)[O-])C7(=N([Mg]35(N1(=C(C(C=C)=C(C)C1=CC=2N34)C=C6(C(C)=C(CCC(=O)OC)C(N56)=C7))))8))))
  • common name:
    • magnesium-protoporphyrin IX 13-monomethyl ester
  • molecular weight:
    • 597.975
  • Synonym(s):
    • Mg-protoporphyrin monomethyl ester
    • magnesium protoporphyrin monomethyl ester
    • MgPMME
    • magnesium-protoporphyrin IX 13-methyl ester
    • MgP monomethyl ester

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"C=CC2(C(C)=C4(C=C8(C(C)=C(CCC(=O)[O-])C7(=N([Mg]35(N1(=C(C(C=C)=C(C)C1=CC=2N34)C=C6(C(C)=C(CCC(=O)OC)C(N56)=C7))))8))))" cannot be used as a page name in this wiki.