Difference between revisions of "Ec-15 002360"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15373 CPD-15373] == * smiles: ** [CH](=O)C(O)C(O)C(O)C(O)CO * inchi key: ** InChIKey=GZCGUP...")
(Created page with "Category:Gene == Gene Ec-15_002360 == * left end position: ** 2576477 * transcription direction: ** POSITIVE * right end position: ** 2582784 * centisome position: ** 47.7...")
 
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15373 CPD-15373] ==
+
== Gene Ec-15_002360 ==
−
* smiles:
+
* left end position:
−
** [CH](=O)C(O)C(O)C(O)C(O)CO
+
** 2576477
−
* inchi key:
+
* transcription direction:
−
** InChIKey=GZCGUPFRVQAUEE-KVTDHHQDSA-N
+
** POSITIVE
−
* common name:
+
* right end position:
−
** aldehydo-D-mannose
+
** 2582784
−
* molecular weight:
+
* centisome position:
−
** 180.157    
+
** 47.727978    
 
* Synonym(s):
 
* Synonym(s):
 +
** Esi_0094_0037
 +
** Esi0094_0037
 +
** GTS
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
* [[RXN-14501]]
+
* Reaction: [[6.1.1.24-RXN]]
−
== Reaction(s) known to produce the compound ==
+
** Source: [[annotation-esiliculosus_genome]]
−
== Reaction(s) of unknown directionality ==
+
*** Assignment: ec-number
−
* [[RXN-14500]]
+
* Reaction: [[RXN-9386]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: ec-number
 +
== Pathways associated ==
 +
* [[PWY-5921]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: left end position=2576477}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=161658 161658]
+
{{#set: transcription direction=POSITIVE}}
−
* CHEBI:
+
{{#set: right end position=2582784}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=37675 37675]
+
{{#set: centisome position=47.727978    }}
−
{{#set: smiles=[CH](=O)C(O)C(O)C(O)C(O)CO}}
+
{{#set: common name=Esi_0094_0037|Esi0094_0037|GTS}}
−
{{#set: inchi key=InChIKey=GZCGUPFRVQAUEE-KVTDHHQDSA-N}}
+
{{#set: reaction associated=6.1.1.24-RXN|RXN-9386}}
−
{{#set: common name=aldehydo-D-mannose}}
+
{{#set: pathway associated=PWY-5921}}
−
{{#set: molecular weight=180.157    }}
+
−
{{#set: consumed by=RXN-14501}}
+
−
{{#set: reversible reaction associated=RXN-14500}}
+

Latest revision as of 20:38, 21 March 2018

Gene Ec-15_002360

  • left end position:
    • 2576477
  • transcription direction:
    • POSITIVE
  • right end position:
    • 2582784
  • centisome position:
    • 47.727978
  • Synonym(s):
    • Esi_0094_0037
    • Esi0094_0037
    • GTS

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=Ec-15_002360&oldid=28373"