Difference between revisions of "Ec-15 002360"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15373 CPD-15373] == * smiles: ** [CH](=O)C(O)C(O)C(O)C(O)CO * inchi key: ** InChIKey=GZCGUP...") |
(Created page with "Category:Gene == Gene Ec-15_002360 == * left end position: ** 2576477 * transcription direction: ** POSITIVE * right end position: ** 2582784 * centisome position: ** 47.7...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Ec-15_002360 == |
− | * | + | * left end position: |
− | ** | + | ** 2576477 |
− | * | + | * transcription direction: |
− | ** | + | ** POSITIVE |
− | * | + | * right end position: |
− | ** | + | ** 2582784 |
− | * | + | * centisome position: |
− | ** | + | ** 47.727978 |
* Synonym(s): | * Synonym(s): | ||
+ | ** Esi_0094_0037 | ||
+ | ** Esi0094_0037 | ||
+ | ** GTS | ||
− | == | + | == Reactions associated == |
− | * [[RXN- | + | * Reaction: [[6.1.1.24-RXN]] |
− | + | ** Source: [[annotation-esiliculosus_genome]] | |
− | == | + | *** Assignment: ec-number |
− | * [[ | + | * Reaction: [[RXN-9386]] |
+ | ** Source: [[annotation-esiliculosus_genome]] | ||
+ | *** Assignment: ec-number | ||
+ | == Pathways associated == | ||
+ | * [[PWY-5921]] | ||
== External links == | == External links == | ||
− | + | {{#set: left end position=2576477}} | |
− | + | {{#set: transcription direction=POSITIVE}} | |
− | + | {{#set: right end position=2582784}} | |
− | + | {{#set: centisome position=47.727978 }} | |
− | {{#set: | + | {{#set: common name=Esi_0094_0037|Esi0094_0037|GTS}} |
− | {{#set: | + | {{#set: reaction associated=6.1.1.24-RXN|RXN-9386}} |
− | {{#set: | + | {{#set: pathway associated=PWY-5921}} |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + |
Latest revision as of 19:38, 21 March 2018
Gene Ec-15_002360
- left end position:
- 2576477
- transcription direction:
- POSITIVE
- right end position:
- 2582784
- centisome position:
- 47.727978
- Synonym(s):
- Esi_0094_0037
- Esi0094_0037
- GTS
Reactions associated
- Reaction: 6.1.1.24-RXN
- Source: annotation-esiliculosus_genome
- Assignment: ec-number
- Source: annotation-esiliculosus_genome
- Reaction: RXN-9386
- Source: annotation-esiliculosus_genome
- Assignment: ec-number
- Source: annotation-esiliculosus_genome