Difference between revisions of "RXN-11368"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=HOMO-CIT HOMO-CIT] == * smiles: ** C(C([O-])=O)CC(O)(C([O-])=O)CC([O-])=O * inchi key: ** InChI...") |
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-11368 RXN-11368] == * direction: ** REVERSIBLE * common name: ** 4-hydroxybenzoate nonaprenyltr...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Reaction]] |
| − | == | + | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-11368 RXN-11368] == |
| − | * | + | * direction: |
| − | ** | + | ** REVERSIBLE |
| − | + | ||
| − | + | ||
* common name: | * common name: | ||
| − | ** | + | ** 4-hydroxybenzoate nonaprenyltransferase |
| − | * | + | * ec number: |
| − | ** | + | ** [http://enzyme.expasy.org/EC/2.5.1.39 EC-2.5.1.39] |
* Synonym(s): | * Synonym(s): | ||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | == Reaction(s) | + | == Reaction Formula == |
| − | * [[ | + | * With identifiers: |
| − | == | + | ** 1 [[4-hydroxybenzoate]][c] '''+''' 1 [[Polyisoprenyl-Diphosphates]][c] '''<=>''' 1 [[PPI]][c] '''+''' 1 [[4-Hydroxy-3-polyprenylbenzoates]][c] |
| − | == | + | * With common name(s): |
| − | * [[ | + | ** 1 4-hydroxybenzoate[c] '''+''' 1 an isoprenoid diphosphate[c] '''<=>''' 1 diphosphate[c] '''+''' 1 a 4-hydroxy-3-polyprenylbenzoate[c] |
| + | |||
| + | == Genes associated with this reaction == | ||
| + | Genes have been associated with this reaction based on different elements listed below. | ||
| + | * Gene: [[Ec-00_007360]] | ||
| + | ** Source: [[annotation-esiliculosus_genome]] | ||
| + | *** Assignment: AUTOMATED-NAME-MATCH | ||
| + | == Pathways == | ||
| + | == Reconstruction information == | ||
| + | * Category: [[annotation]] | ||
| + | ** Source: [[annotation-esiliculosus_genome]] | ||
| + | *** Tool: [[pathwaytools]] | ||
== External links == | == External links == | ||
| − | + | * LIGAND-RXN: | |
| − | + | ** [http://www.genome.jp/dbget-bin/www_bget?R05000 R05000] | |
| − | + | {{#set: direction=REVERSIBLE}} | |
| − | + | {{#set: common name=4-hydroxybenzoate nonaprenyltransferase}} | |
| − | * LIGAND- | + | {{#set: ec number=EC-2.5.1.39}} |
| − | ** [http://www.genome.jp/dbget-bin/www_bget? | + | {{#set: gene associated=Ec-00_007360}} |
| − | + | {{#set: in pathway=}} | |
| − | + | {{#set: reconstruction category=annotation}} | |
| − | + | {{#set: reconstruction source=annotation-esiliculosus_genome}} | |
| − | + | {{#set: reconstruction tool=pathwaytools}} | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
Latest revision as of 19:40, 21 March 2018
Contents
Reaction RXN-11368
- direction:
- REVERSIBLE
- common name:
- 4-hydroxybenzoate nonaprenyltransferase
- ec number:
- Synonym(s):
Reaction Formula
- With identifiers:
- 1 4-hydroxybenzoate[c] + 1 Polyisoprenyl-Diphosphates[c] <=> 1 PPI[c] + 1 4-Hydroxy-3-polyprenylbenzoates[c]
- With common name(s):
- 1 4-hydroxybenzoate[c] + 1 an isoprenoid diphosphate[c] <=> 1 diphosphate[c] + 1 a 4-hydroxy-3-polyprenylbenzoate[c]
Genes associated with this reaction
Genes have been associated with this reaction based on different elements listed below.
- Gene: Ec-00_007360
- Source: annotation-esiliculosus_genome
- Assignment: AUTOMATED-NAME-MATCH
- Source: annotation-esiliculosus_genome
Pathways
Reconstruction information
- Category: annotation
- Source: annotation-esiliculosus_genome
- Tool: pathwaytools
- Source: annotation-esiliculosus_genome
External links
- LIGAND-RXN:
