Difference between revisions of "THZ-P"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-12460 RXN-12460] == * direction: ** LEFT-TO-RIGHT * common name: ** L-asparaginyl-tRNAasn hydro...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=THZ-P THZ-P] == * smiles: ** CC1(N=CSC(CCOP([O-])(=O)[O-])=1) * inchi key: ** InChIKey=OCYMERZC...")
 
Line 1: Line 1:
−
[[Category:Reaction]]
+
[[Category:Metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-12460 RXN-12460] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=THZ-P THZ-P] ==
−
* direction:
+
* smiles:
−
** LEFT-TO-RIGHT
+
** CC1(N=CSC(CCOP([O-])(=O)[O-])=1)
 +
* inchi key:
 +
** InChIKey=OCYMERZCMYJQQO-UHFFFAOYSA-L
 
* common name:
 
* common name:
−
** L-asparaginyl-tRNAasn hydrolase
+
** 4-methyl-5-(2-phosphooxyethyl)thiazole
−
** aminoacyl-tRNA hydrolase
+
* molecular weight:
−
* ec number:
+
** 221.167   
−
** [http://enzyme.expasy.org/EC/3.1.1.29 EC-3.1.1.29]
+
 
* Synonym(s):
 
* Synonym(s):
 +
** 4-4-methyl-5-(2-phosphonooxyethyl)-thiazole
 +
** 4-methyl-5-(2-phosphoethyl)-thiazole
 +
** THZ-P
 +
** 4-methyl-5-(β-hydroxyethyl)thiazole phosphate
 +
** HET-P
  
−
== Reaction Formula ==
+
== Reaction(s) known to consume the compound ==
−
* With identifiers:
+
* [[THI-P-SYN-RXN]]
−
** 1 [[WATER]][c] '''+''' 1 [[Charged-ASN-tRNAs]][c] '''=>''' 1 [[ASN-tRNAs]][c] '''+''' 2 [[PROTON]][c] '''+''' 1 [[ASN]][c]
+
== Reaction(s) known to produce the compound ==
−
* With common name(s):
+
* [[THIAZOLSYN3-RXN]]
−
** 1 H2O[c] '''+''' 1 an L-asparaginyl-[tRNAasn][c] '''=>''' 1 tRNAasn[c] '''+''' 2 H+[c] '''+''' 1 L-asparagine[c]
+
== Reaction(s) of unknown directionality ==
−
 
+
−
== Genes associated with this reaction  ==
+
−
Genes have been associated with this reaction based on different elements listed below.
+
−
* Gene: [[Ec-07_007720]]
+
−
** Source: [[annotation-esiliculosus_genome]]
+
−
*** Assignment: GO-TERM
+
−
* Gene: [[Ec-26_001700]]
+
−
** Source: [[annotation-esiliculosus_genome]]
+
−
*** Assignment: GO-TERM
+
−
* Gene: [[Ec-07_007410]]
+
−
** Source: [[annotation-esiliculosus_genome]]
+
−
*** Assignment: GO-TERM
+
−
* Gene: [[Ec-07_007430]]
+
−
** Source: [[annotation-esiliculosus_genome]]
+
−
*** Assignment: GO-TERM
+
−
== Pathways  ==
+
−
* [[PWY490-4]], L-asparagine biosynthesis III (tRNA-dependent): [http://metacyc.org/META/NEW-IMAGE?object=PWY490-4 PWY490-4]
+
−
** '''2''' reactions found over '''3''' reactions in the full pathway
+
−
== Reconstruction information  ==
+
−
* Category: [[annotation]]
+
−
** Source: [[annotation-esiliculosus_genome]]
+
−
*** Tool: [[pathwaytools]]
+
 
== External links  ==
 
== External links  ==
−
{{#set: direction=LEFT-TO-RIGHT}}
+
* PUBCHEM:
−
{{#set: common name=L-asparaginyl-tRNAasn hydrolase}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25245616 25245616]
−
{{#set: common name=aminoacyl-tRNA hydrolase}}
+
* CHEBI:
−
{{#set: ec number=EC-3.1.1.29}}
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58296 58296]
−
{{#set: gene associated=Ec-07_007720|Ec-26_001700|Ec-07_007410|Ec-07_007430}}
+
* BIGG : 43602
−
{{#set: in pathway=PWY490-4}}
+
* LIGAND-CPD:
−
{{#set: reconstruction category=annotation}}
+
** [http://www.genome.jp/dbget-bin/www_bget?C04327 C04327]
−
{{#set: reconstruction source=annotation-esiliculosus_genome}}
+
{{#set: smiles=CC1(N=CSC(CCOP([O-])(=O)[O-])=1)}}
−
{{#set: reconstruction tool=pathwaytools}}
+
{{#set: inchi key=InChIKey=OCYMERZCMYJQQO-UHFFFAOYSA-L}}
 +
{{#set: common name=4-methyl-5-(2-phosphooxyethyl)thiazole}}
 +
{{#set: molecular weight=221.167    }}
 +
{{#set: common name=4-4-methyl-5-(2-phosphonooxyethyl)-thiazole|4-methyl-5-(2-phosphoethyl)-thiazole|THZ-P|4-methyl-5-(β-hydroxyethyl)thiazole phosphate|HET-P}}
 +
{{#set: consumed by=THI-P-SYN-RXN}}
 +
{{#set: produced by=THIAZOLSYN3-RXN}}

Latest revision as of 19:40, 21 March 2018

Metabolite THZ-P

  • smiles:
    • CC1(N=CSC(CCOP([O-])(=O)[O-])=1)
  • inchi key:
    • InChIKey=OCYMERZCMYJQQO-UHFFFAOYSA-L
  • common name:
    • 4-methyl-5-(2-phosphooxyethyl)thiazole
  • molecular weight:
    • 221.167
  • Synonym(s):
    • 4-4-methyl-5-(2-phosphonooxyethyl)-thiazole
    • 4-methyl-5-(2-phosphoethyl)-thiazole
    • THZ-P
    • 4-methyl-5-(β-hydroxyethyl)thiazole phosphate
    • HET-P

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"CC1(N=CSC(CCOP([O-])(=O)[O-])=1)" cannot be used as a page name in this wiki.




Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=THZ-P&oldid=28560"