Difference between revisions of "RXN-10994"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=44-DIMETHYL-824-CHOLESTADIENOL 44-DIMETHYL-824-CHOLESTADIENOL] == * smiles: ** CC(C)=CCCC(C)[CH...")
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-10994 RXN-10994] == * direction: ** REVERSIBLE * common name: ** holo-[acyl-carrier-protein] sy...")
 
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Reaction]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=44-DIMETHYL-824-CHOLESTADIENOL 44-DIMETHYL-824-CHOLESTADIENOL] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-10994 RXN-10994] ==
−
* smiles:
+
* direction:
−
** CC(C)=CCCC(C)[CH]3(CC[CH]4(C2(CC[CH]1(C(C)(C)C(O)CCC(C)1C=2CCC(C)34))))
+
** REVERSIBLE
−
* inchi key:
+
−
** InChIKey=CHGIKSSZNBCNDW-QGBOJXOESA-N
+
 
* common name:
 
* common name:
−
** 4,4-dimethylzymosterol
+
** holo-[acyl-carrier-protein] synthase
−
* molecular weight:
+
* ec number:
−
** 412.698   
+
** [http://enzyme.expasy.org/EC/2.7.8.7 EC-2.7.8.7]
 
* Synonym(s):
 
* Synonym(s):
−
** 4,4-dimethyl-8,24-cholestadienol
 
−
** 4,4-dimethyl-5α-cholesta-8,24-dien-3β-ol
 
−
** 14-demethyllanosterol
 
−
** 17-(1,5-dimethylhex-4-enyl)-4,4,10,13-tetramethyl-2,3,4,5,6,7, 10,11,12,13,14,15,16,17-tetradecahydro-1H-cyclopenta[a] phenanthren-3-ol
 
−
** 4,4-dimethyl-5α-cholesta-8,24-dien-3-β-ol
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
−
== Reaction(s) known to produce the compound ==
+
* With identifiers:
−
* [[RXN66-306]]
+
** 1 [[VibB]][c] '''+''' 1 [[CO-A]][c] '''<=>''' 1 [[3-5-ADP]][c] '''+''' 1 [[holo-VibB]][c] '''+''' 1 [[PROTON]][c]
−
== Reaction(s) of unknown directionality ==
+
* With common name(s):
 +
** 1 an apo-[VibB aryl-carrier protein][c] '''+''' 1 coenzyme A[c] '''<=>''' 1 adenosine 3',5'-bisphosphate[c] '''+''' 1 a holo-[VibB aryl-carrier protein][c] '''+''' 1 H+[c]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* Gene: [[Ec-06_004620]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: GO-TERM
 +
* Gene: [[Ec-01_000130]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: GO-TERM
 +
== Pathways  ==
 +
== Reconstruction information  ==
 +
* Category: [[annotation]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Tool: [[pathwaytools]]
 
== External links  ==
 
== External links  ==
−
* LIGAND-CPD:
+
{{#set: direction=REVERSIBLE}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C05108 C05108]
+
{{#set: common name=holo-[acyl-carrier-protein] synthase}}
−
* CHEBI:
+
{{#set: ec number=EC-2.7.8.7}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=18364 18364]
+
{{#set: gene associated=Ec-06_004620|Ec-01_000130}}
−
* METABOLIGHTS : MTBLC18364
+
{{#set: in pathway=}}
−
* PUBCHEM:
+
{{#set: reconstruction category=annotation}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=165609 165609]
+
{{#set: reconstruction source=annotation-esiliculosus_genome}}
−
* HMDB : HMDB01286
+
{{#set: reconstruction tool=pathwaytools}}
−
{{#set: smiles=CC(C)=CCCC(C)[CH]3(CC[CH]4(C2(CC[CH]1(C(C)(C)C(O)CCC(C)1C=2CCC(C)34))))}}
+
−
{{#set: inchi key=InChIKey=CHGIKSSZNBCNDW-QGBOJXOESA-N}}
+
−
{{#set: common name=4,4-dimethylzymosterol}}
+
−
{{#set: molecular weight=412.698    }}
+
−
{{#set: common name=4,4-dimethyl-8,24-cholestadienol|4,4-dimethyl-5&alpha;-cholesta-8,24-dien-3&beta;-ol|14-demethyllanosterol|17-(1,5-dimethylhex-4-enyl)-4,4,10,13-tetramethyl-2,3,4,5,6,7, 10,11,12,13,14,15,16,17-tetradecahydro-1H-cyclopenta[a] phenanthren-3-ol|4,4-dimethyl-5&alpha;-cholesta-8,24-dien-3-&beta;-ol}}
+
−
{{#set: produced by=RXN66-306}}
+

Latest revision as of 19:40, 21 March 2018

Reaction RXN-10994

  • direction:
    • REVERSIBLE
  • common name:
    • holo-[acyl-carrier-protein] synthase
  • ec number:
  • Synonym(s):

Reaction Formula

  • With identifiers:
  • With common name(s):
    • 1 an apo-[VibB aryl-carrier protein][c] + 1 coenzyme A[c] <=> 1 adenosine 3',5'-bisphosphate[c] + 1 a holo-[VibB aryl-carrier protein][c] + 1 H+[c]

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

Reconstruction information

External links

"holo-[acyl-carrier-protein] synthase" cannot be used as a page name in this wiki.




Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=RXN-10994&oldid=28615"