Difference between revisions of "2-3-CARBOXY-3-METHYLAMMONIOPROPYL-L-"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12014 CPD-12014] == * smiles: ** CC(=O)NCCC1(=CNC2(C1=CC(OC)=C(O)C=2)) * inchi key: ** InCh...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=2-3-CARBOXY-3-METHYLAMMONIOPROPYL-L- 2-3-CARBOXY-3-METHYLAMMONIOPROPYL-L-] == * common name: **...") |
||
Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=2-3-CARBOXY-3-METHYLAMMONIOPROPYL-L- 2-3-CARBOXY-3-METHYLAMMONIOPROPYL-L-] == |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
* common name: | * common name: | ||
− | ** | + | ** a 2-[(3S)-3-carboxy-3-(methylammonio)propyl]-L-histidine-[translation elongation factor 2] |
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
+ | ** a [3-[[4-(2-amino-2-carboxy-ethyl)-1H-imidazol-2-yl]]-1-carboxy- propyl]-methyl-ammonium | ||
+ | ** a 2-[3-carboxy-3-(methylammonio)propyl]-L-histidine | ||
+ | ** 2-[3-carboxy-3-(methylammonio)propyl]-L-histidine in eEF-2 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[RXN- | + | * [[RXN-11374]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[RXN- | + | * [[RXN-11370]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
− | + | {{#set: common name=a 2-[(3S)-3-carboxy-3-(methylammonio)propyl]-L-histidine-[translation elongation factor 2]}} | |
− | + | {{#set: common name=a [3-[[4-(2-amino-2-carboxy-ethyl)-1H-imidazol-2-yl]]-1-carboxy- propyl]-methyl-ammonium|a 2-[3-carboxy-3-(methylammonio)propyl]-L-histidine|2-[3-carboxy-3-(methylammonio)propyl]-L-histidine in eEF-2}} | |
− | + | {{#set: consumed by=RXN-11374}} | |
− | + | {{#set: produced by=RXN-11370}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | + | ||
− | + | ||
− | + | ||
− | {{#set: consumed by=RXN- | + | |
− | {{#set: produced by=RXN- | + |
Latest revision as of 19:40, 21 March 2018
Contents
Metabolite 2-3-CARBOXY-3-METHYLAMMONIOPROPYL-L-
- common name:
- a 2-[(3S)-3-carboxy-3-(methylammonio)propyl]-L-histidine-[translation elongation factor 2]
- Synonym(s):
- a [3-4-(2-amino-2-carboxy-ethyl)-1H-imidazol-2-yl-1-carboxy- propyl]-methyl-ammonium
- a 2-[3-carboxy-3-(methylammonio)propyl]-L-histidine
- 2-[3-carboxy-3-(methylammonio)propyl]-L-histidine in eEF-2
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"a 2-[(3S)-3-carboxy-3-(methylammonio)propyl]-L-histidine-[translation elongation factor 2" cannot be used as a page name in this wiki.
- "a [3-4-(2-amino-2-carboxy-ethyl)-1H-imidazol-2-yl-1-carboxy- propyl]-methyl-ammonium" cannot be used as a page name in this wiki.
- "a 2-[3-carboxy-3-(methylammonio)propyl]-L-histidine" cannot be used as a page name in this wiki.
- "2-[3-carboxy-3-(methylammonio)propyl]-L-histidine in eEF-2" cannot be used as a page name in this wiki.