Difference between revisions of "CPD1F-132"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=LEU-tRNAs LEU-tRNAs] == * common name: ** a tRNAleu * Synonym(s): ** TRNA(LEU) == Reaction(s)...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD1F-132 CPD1F-132] == * smiles: ** C=C1(C4(CC3(C1)(CC[CH]2(C(C)(C([O-])=O)CCCC(C)2[CH]3CC4)))...")
 
Line 1: Line 1:
 
[[Category:Metabolite]]
 
[[Category:Metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=LEU-tRNAs LEU-tRNAs] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD1F-132 CPD1F-132] ==
 +
* smiles:
 +
** C=C1(C4(CC3(C1)(CC[CH]2(C(C)(C([O-])=O)CCCC(C)2[CH]3CC4))))
 +
* inchi key:
 +
** InChIKey=NIKHGUQULKYIGE-OTCXFQBHSA-M
 
* common name:
 
* common name:
** a tRNAleu
+
** ent-kaur-16-en-19-oate
 +
* molecular weight:
 +
** 301.448   
 
* Synonym(s):
 
* Synonym(s):
** TRNA(LEU)
+
** ent-kaurenoate
 +
** ent-kaurenoic acid
  
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[LEUCINE--TRNA-LIGASE-RXN]]
+
* [[1.14.13.79-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
 
== External links  ==
 
== External links  ==
{{#set: common name=a tRNAleu}}
+
* LIPID_MAPS : LMPR0104130004
{{#set: common name=TRNA(LEU)}}
+
* PUBCHEM:
{{#set: consumed by=LEUCINE--TRNA-LIGASE-RXN}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25200785 25200785]
 +
* CHEBI:
 +
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57297 57297]
 +
* LIGAND-CPD:
 +
** [http://www.genome.jp/dbget-bin/www_bget?C11874 C11874]
 +
{{#set: smiles=C=C1(C4(CC3(C1)(CC[CH]2(C(C)(C([O-])=O)CCCC(C)2[CH]3CC4))))}}
 +
{{#set: inchi key=InChIKey=NIKHGUQULKYIGE-OTCXFQBHSA-M}}
 +
{{#set: common name=ent-kaur-16-en-19-oate}}
 +
{{#set: molecular weight=301.448    }}
 +
{{#set: common name=ent-kaurenoate|ent-kaurenoic acid}}
 +
{{#set: consumed by=1.14.13.79-RXN}}

Latest revision as of 19:41, 21 March 2018

Metabolite CPD1F-132

  • smiles:
    • C=C1(C4(CC3(C1)(CC[CH]2(C(C)(C([O-])=O)CCCC(C)2[CH]3CC4))))
  • inchi key:
    • InChIKey=NIKHGUQULKYIGE-OTCXFQBHSA-M
  • common name:
    • ent-kaur-16-en-19-oate
  • molecular weight:
    • 301.448
  • Synonym(s):
    • ent-kaurenoate
    • ent-kaurenoic acid

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"C=C1(C4(CC3(C1)(CC[CH]2(C(C)(C([O-])=O)CCCC(C)2[CH]3CC4))))" cannot be used as a page name in this wiki.