Difference between revisions of "Ec-01 011310"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DEHYDROQUINATE DEHYDROQUINATE] == * smiles: ** C1(C(O)C(O)C(=O)CC(O)(C([O-])=O)1) * inchi key:...") |
(Created page with "Category:Gene == Gene Ec-01_011310 == * left end position: ** 9433473 * transcription direction: ** NEGATIVE * right end position: ** 9439484 * centisome position: ** 91.4...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Ec-01_011310 == |
− | * | + | * left end position: |
− | ** | + | ** 9433473 |
− | * | + | * transcription direction: |
− | ** | + | ** NEGATIVE |
− | * | + | * right end position: |
− | ** | + | ** 9439484 |
− | * | + | * centisome position: |
− | ** | + | ** 91.41995 |
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** Esi_0008_0167 |
− | ** | + | ** Esi0008_0167 |
− | + | ||
− | + | ||
− | + | ||
− | == | + | == Reactions associated == |
− | + | * Reaction: [[5.99.1.2-RXN]] | |
− | + | ** Source: [[annotation-esiliculosus_genome]] | |
− | * [[ | + | *** Assignment: go-term |
− | * | + | == Pathways associated == |
− | == | + | |
− | + | ||
== External links == | == External links == | ||
− | + | {{#set: left end position=9433473}} | |
− | + | {{#set: transcription direction=NEGATIVE}} | |
− | + | {{#set: right end position=9439484}} | |
− | + | {{#set: centisome position=91.41995 }} | |
− | + | {{#set: common name=Esi_0008_0167|Esi0008_0167}} | |
− | + | {{#set: reaction associated=5.99.1.2-RXN}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: common name= | + | |
− | {{#set: | + | |
− | + |
Latest revision as of 20:41, 21 March 2018
Gene Ec-01_011310
- left end position:
- 9433473
- transcription direction:
- NEGATIVE
- right end position:
- 9439484
- centisome position:
- 91.41995
- Synonym(s):
- Esi_0008_0167
- Esi0008_0167
Reactions associated
- Reaction: 5.99.1.2-RXN
- Source: annotation-esiliculosus_genome
- Assignment: go-term
- Source: annotation-esiliculosus_genome