Difference between revisions of "CPD-67"
From metabolic_network
(Created page with "Category:Gene == Gene Ec-03_003270 == * left end position: ** 3771444 * transcription direction: ** POSITIVE * right end position: ** 3776829 * centisome position: ** 57.7...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-67 CPD-67] == * smiles: ** C(OP([O-])(=O)[O-])C([O-])=O * inchi key: ** InChIKey=ASCFNMCAHF...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-67 CPD-67] == |
− | * | + | * smiles: |
− | ** | + | ** C(OP([O-])(=O)[O-])C([O-])=O |
− | * | + | * inchi key: |
− | ** | + | ** InChIKey=ASCFNMCAHFUBCO-UHFFFAOYSA-K |
− | * | + | * common name: |
− | ** | + | ** 2-phosphoglycolate |
− | * | + | * molecular weight: |
− | ** | + | ** 153.008 |
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** 2-P-glycolate |
− | ** | + | ** phosphoglycolate |
− | ** | + | ** Phosphoglycolic acid |
− | == | + | == Reaction(s) known to consume the compound == |
− | * | + | * [[GPH-RXN]] |
− | + | == Reaction(s) known to produce the compound == | |
− | + | * [[RXN-961]] | |
− | * | + | == Reaction(s) of unknown directionality == |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | == | + | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
== External links == | == External links == | ||
− | {{#set: | + | * BIGG : 2pglyc |
− | {{#set: | + | * PUBCHEM: |
− | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=24916760 24916760] |
− | {{#set: | + | * HMDB : HMDB00816 |
− | {{#set: common name= | + | * LIGAND-CPD: |
− | {{#set: | + | ** [http://www.genome.jp/dbget-bin/www_bget?C00988 C00988] |
− | {{#set: | + | * CHEBI: |
+ | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58033 58033] | ||
+ | * METABOLIGHTS : MTBLC58033 | ||
+ | {{#set: smiles=C(OP([O-])(=O)[O-])C([O-])=O}} | ||
+ | {{#set: inchi key=InChIKey=ASCFNMCAHFUBCO-UHFFFAOYSA-K}} | ||
+ | {{#set: common name=2-phosphoglycolate}} | ||
+ | {{#set: molecular weight=153.008 }} | ||
+ | {{#set: common name=2-P-glycolate|phosphoglycolate|Phosphoglycolic acid}} | ||
+ | {{#set: consumed by=GPH-RXN}} | ||
+ | {{#set: produced by=RXN-961}} |
Latest revision as of 19:41, 21 March 2018
Contents
Metabolite CPD-67
- smiles:
- C(OP([O-])(=O)[O-])C([O-])=O
- inchi key:
- InChIKey=ASCFNMCAHFUBCO-UHFFFAOYSA-K
- common name:
- 2-phosphoglycolate
- molecular weight:
- 153.008
- Synonym(s):
- 2-P-glycolate
- phosphoglycolate
- Phosphoglycolic acid
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- BIGG : 2pglyc
- PUBCHEM:
- HMDB : HMDB00816
- LIGAND-CPD:
- CHEBI:
- METABOLIGHTS : MTBLC58033
"C(OP([O-])(=O)[O-])C([O-])=O" cannot be used as a page name in this wiki.