Difference between revisions of "3OH-4P-OH-ALPHA-KETOBUTYRATE"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-15745 RXN-15745] == * direction: ** LEFT-TO-RIGHT * common name: ** glycerol-3-phosphate dehydr...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=3OH-4P-OH-ALPHA-KETOBUTYRATE 3OH-4P-OH-ALPHA-KETOBUTYRATE] == * smiles: ** C(C(C(C([O-])=O)=O)O...")
 
Line 1: Line 1:
[[Category:Reaction]]
+
[[Category:Metabolite]]
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-15745 RXN-15745] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=3OH-4P-OH-ALPHA-KETOBUTYRATE 3OH-4P-OH-ALPHA-KETOBUTYRATE] ==
* direction:
+
* smiles:
** LEFT-TO-RIGHT
+
** C(C(C(C([O-])=O)=O)O)OP([O-])(=O)[O-]
 +
* inchi key:
 +
** InChIKey=MZJFVXDTNBHTKZ-UWTATZPHSA-K
 
* common name:
 
* common name:
** glycerol-3-phosphate dehydrogenase
+
** (3R)-3-hydroxy-2-oxo-4 phosphonooxybutanoate
* ec number:
+
* molecular weight:
** [http://enzyme.expasy.org/EC/1.1.5.3 EC-1.1.5.3]
+
** 211.045   
 
* Synonym(s):
 
* Synonym(s):
 +
** 3-hydroxy-4-phospho-hydroxy-α-ketobutyrate
 +
** 2-oxo-3-hydroxy-4-phosphobutanoate
  
== Reaction Formula ==
+
== Reaction(s) known to consume the compound ==
* With identifiers:
+
== Reaction(s) known to produce the compound ==
** 1 [[ETR-Quinones]][c] '''+''' 1 [[GLYCEROL-3P]][c] '''=>''' 1 [[ETR-Quinols]][c] '''+''' 1 [[DIHYDROXY-ACETONE-PHOSPHATE]][c]
+
== Reaction(s) of unknown directionality ==
* With common name(s):
+
* [[PSERTRANSAMPYR-RXN]]
** 1 an electron-transfer quinone[c] '''+''' 1 sn-glycerol 3-phosphate[c] '''=>''' 1 an electron-transfer quinol[c] '''+''' 1 glycerone phosphate[c]
+
 
+
== Genes associated with this reaction  ==
+
Genes have been associated with this reaction based on different elements listed below.
+
* Gene: [[Ec-10_003310]]
+
** Source: [[annotation-esiliculosus_genome]]
+
*** Assignment: GO-TERM
+
== Pathways  ==
+
== Reconstruction information  ==
+
* Category: [[annotation]]
+
** Source: [[annotation-esiliculosus_genome]]
+
*** Tool: [[pathwaytools]]
+
 
== External links  ==
 
== External links  ==
{{#set: direction=LEFT-TO-RIGHT}}
+
* LIGAND-CPD:
{{#set: common name=glycerol-3-phosphate dehydrogenase}}
+
** [http://www.genome.jp/dbget-bin/www_bget?C06054 C06054]
{{#set: ec number=EC-1.1.5.3}}
+
* CHEBI:
{{#set: gene associated=Ec-10_003310}}
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58538 58538]
{{#set: in pathway=}}
+
* BIGG : 1447403
{{#set: reconstruction category=annotation}}
+
* PUBCHEM:
{{#set: reconstruction source=annotation-esiliculosus_genome}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=45266680 45266680]
{{#set: reconstruction tool=pathwaytools}}
+
* HMDB : HMDB06801
 +
{{#set: smiles=C(C(C(C([O-])=O)=O)O)OP([O-])(=O)[O-]}}
 +
{{#set: inchi key=InChIKey=MZJFVXDTNBHTKZ-UWTATZPHSA-K}}
 +
{{#set: common name=(3R)-3-hydroxy-2-oxo-4 phosphonooxybutanoate}}
 +
{{#set: molecular weight=211.045    }}
 +
{{#set: common name=3-hydroxy-4-phospho-hydroxy-α-ketobutyrate|2-oxo-3-hydroxy-4-phosphobutanoate}}
 +
{{#set: reversible reaction associated=PSERTRANSAMPYR-RXN}}

Latest revision as of 19:41, 21 March 2018

Metabolite 3OH-4P-OH-ALPHA-KETOBUTYRATE

  • smiles:
    • C(C(C(C([O-])=O)=O)O)OP([O-])(=O)[O-]
  • inchi key:
    • InChIKey=MZJFVXDTNBHTKZ-UWTATZPHSA-K
  • common name:
    • (3R)-3-hydroxy-2-oxo-4 phosphonooxybutanoate
  • molecular weight:
    • 211.045
  • Synonym(s):
    • 3-hydroxy-4-phospho-hydroxy-α-ketobutyrate
    • 2-oxo-3-hydroxy-4-phosphobutanoate

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"C(C(C(C([O-])=O)=O)O)OP([O-])(=O)[O-" cannot be used as a page name in this wiki.