Difference between revisions of "CHD-RXN"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=CYTIDEAM2-RXN CYTIDEAM2-RXN] == * direction: ** LEFT-TO-RIGHT * ec number: ** [http://enzyme.expasy...")
 
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CDP-CHOLINE CDP-CHOLINE] == * smiles: ** C[N+](C)(C)CCOP([O-])(=O)OP([O-])(=O)OCC1(OC(C(O)C(O)1...")
Line 1: Line 1:
−
[[Category:Reaction]]
+
[[Category:Metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=CYTIDEAM2-RXN CYTIDEAM2-RXN] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CDP-CHOLINE CDP-CHOLINE] ==
−
* direction:
+
* smiles:
−
** LEFT-TO-RIGHT
+
** C[N+](C)(C)CCOP([O-])(=O)OP([O-])(=O)OCC1(OC(C(O)C(O)1)N2(C=CC(=NC2=O)N))
−
* ec number:
+
* inchi key:
−
** [http://enzyme.expasy.org/EC/3.5.4.5 EC-3.5.4.5]
+
** InChIKey=RZZPDXZPRHQOCG-OJAKKHQRSA-M
 +
* common name:
 +
** CDP-choline
 +
* molecular weight:
 +
** 487.319   
 
* Synonym(s):
 
* Synonym(s):
 +
** citicoline
 +
** citicholine
 +
** cidifos
 +
** cyticholine
 +
** cytidine 5'-diphosphocholine
 +
** cytidine diphosphate choline
  
−
== Reaction Formula ==
+
== Reaction(s) known to consume the compound ==
−
* With identifiers:
+
== Reaction(s) known to produce the compound ==
−
** 1 [[WATER]][c] '''+''' 1 [[CYTIDINE]][c] '''+''' 1 [[PROTON]][c] '''=>''' 1 [[URIDINE]][c] '''+''' 1 [[AMMONIUM]][c]
+
* [[2.7.7.15-RXN]]
−
* With common name(s):
+
== Reaction(s) of unknown directionality ==
−
** 1 H2O[c] '''+''' 1 cytidine[c] '''+''' 1 H+[c] '''=>''' 1 uridine[c] '''+''' 1 ammonium[c]
+
* [[RXN-5781]]
−
 
+
−
== Genes associated with this reaction  ==
+
−
== Pathways  ==
+
−
* [[PWY-7193]], pyrimidine ribonucleosides salvage I: [http://metacyc.org/META/NEW-IMAGE?object=PWY-7193 PWY-7193]
+
−
** '''3''' reactions found over '''3''' reactions in the full pathway
+
−
* [[PWY0-1295]], pyrimidine ribonucleosides degradation: [http://metacyc.org/META/NEW-IMAGE?object=PWY0-1295 PWY0-1295]
+
−
** '''1''' reactions found over '''2''' reactions in the full pathway
+
−
* [[PWY-6556]], pyrimidine ribonucleosides salvage II: [http://metacyc.org/META/NEW-IMAGE?object=PWY-6556 PWY-6556]
+
−
** '''1''' reactions found over '''2''' reactions in the full pathway
+
−
== Reconstruction information  ==
+
−
* [[annotation]]:
+
−
** [[pathwaytools]]:
+
−
*** [[esiliculosus_genome]]
+
 
== External links  ==
 
== External links  ==
−
* RHEA:
+
* CAS : 987-78-0
−
** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=16069 16069]
+
* PUBCHEM:
−
* LIGAND-RXN:
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25202509 25202509]
−
** [http://www.genome.jp/dbget-bin/www_bget?R01878 R01878]
+
* CHEBI:
−
* UNIPROT:
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58779 58779]
−
** [http://www.uniprot.org/uniprot/P47718 P47718]
+
* LIGAND-CPD:
−
** [http://www.uniprot.org/uniprot/P0ABF6 P0ABF6]
+
** [http://www.genome.jp/dbget-bin/www_bget?C00307 C00307]
−
** [http://www.uniprot.org/uniprot/P47298 P47298]
+
* HMDB : HMDB01413
−
** [http://www.uniprot.org/uniprot/Q9CFM8 Q9CFM8]
+
{{#set: smiles=C[N+](C)(C)CCOP([O-])(=O)OP([O-])(=O)OCC1(OC(C(O)C(O)1)N2(C=CC(=NC2=O)N))}}
−
** [http://www.uniprot.org/uniprot/P32320 P32320]
+
{{#set: inchi key=InChIKey=RZZPDXZPRHQOCG-OJAKKHQRSA-M}}
−
** [http://www.uniprot.org/uniprot/P75051 P75051]
+
{{#set: common name=CDP-choline}}
−
** [http://www.uniprot.org/uniprot/Q9SU87 Q9SU87]
+
{{#set: molecular weight=487.319    }}
−
** [http://www.uniprot.org/uniprot/Q9SU86 Q9SU86]
+
{{#set: common name=citicoline|citicholine|cidifos|cyticholine|cytidine 5'-diphosphocholine|cytidine diphosphate choline}}
−
** [http://www.uniprot.org/uniprot/O65571 O65571]
+
{{#set: produced by=2.7.7.15-RXN}}
−
** [http://www.uniprot.org/uniprot/Q9S847 Q9S847]
+
{{#set: reversible reaction associated=RXN-5781}}
−
** [http://www.uniprot.org/uniprot/Q9S7L8 Q9S7L8]
+
−
** [http://www.uniprot.org/uniprot/Q9S7S2 Q9S7S2]
+
−
** [http://www.uniprot.org/uniprot/O65896 O65896]
+
−
{{#set: direction=LEFT-TO-RIGHT}}
+
−
{{#set: ec number=EC-3.5.4.5}}
+
−
{{#set: in pathway=PWY-7193|PWY0-1295|PWY-6556}}
+
−
{{#set: reconstruction category=annotation}}
+
−
{{#set: reconstruction tool=pathwaytools}}
+
−
{{#set: reconstruction source=esiliculosus_genome}}
+

Revision as of 21:52, 17 March 2018

Metabolite CDP-CHOLINE

  • smiles:
    • C[N+](C)(C)CCOP([O-])(=O)OP([O-])(=O)OCC1(OC(C(O)C(O)1)N2(C=CC(=NC2=O)N))
  • inchi key:
    • InChIKey=RZZPDXZPRHQOCG-OJAKKHQRSA-M
  • common name:
    • CDP-choline
  • molecular weight:
    • 487.319
  • Synonym(s):
    • citicoline
    • citicholine
    • cidifos
    • cyticholine
    • cytidine 5'-diphosphocholine
    • cytidine diphosphate choline

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"C[N+](C)(C)CCOP([O-])(=O)OP([O-])(=O)OCC1(OC(C(O)C(O)1)N2(C=CC(=NC2=O)N))" cannot be used as a page name in this wiki.




Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=CHD-RXN&oldid=10728"