Difference between revisions of "CPD-11020"
From metabolic_network
(Created page with "Category:Gene == Gene Ec-10_003770 == * left end position: ** 3818570 * transcription direction: ** POSITIVE * right end position: ** 3827446 * centisome position: ** 58.7...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11020 CPD-11020] == * smiles: ** C(=O)([O-])C(=O)CC(O)CCl * inchi key: ** InChIKey=FHWPHVIG...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11020 CPD-11020] == |
− | * | + | * smiles: |
− | ** | + | ** C(=O)([O-])C(=O)CC(O)CCl |
− | * | + | * inchi key: |
− | ** | + | ** InChIKey=FHWPHVIGZZAXIQ-VKHMYHEASA-M |
− | * | + | * common name: |
− | ** | + | ** 5-chloro-4-hydroxy-2-oxopentanoate |
− | * | + | * molecular weight: |
− | ** | + | ** 165.553 |
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** 5-chloro-4-hydroxy-2-oxovalerate |
− | + | ||
− | == | + | == Reaction(s) known to consume the compound == |
− | + | == Reaction(s) known to produce the compound == | |
− | * | + | * [[RXN-11717]] |
− | + | == Reaction(s) of unknown directionality == | |
− | == | + | |
== External links == | == External links == | ||
− | {{#set: | + | * PUBCHEM: |
− | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=49859580 49859580] |
− | {{#set: | + | {{#set: smiles=C(=O)([O-])C(=O)CC(O)CCl}} |
− | {{#set: | + | {{#set: inchi key=InChIKey=FHWPHVIGZZAXIQ-VKHMYHEASA-M}} |
− | {{#set: common name= | + | {{#set: common name=5-chloro-4-hydroxy-2-oxopentanoate}} |
− | {{#set: | + | {{#set: molecular weight=165.553 }} |
+ | {{#set: common name=5-chloro-4-hydroxy-2-oxovalerate}} | ||
+ | {{#set: produced by=RXN-11717}} |
Latest revision as of 20:42, 21 March 2018
Contents
Metabolite CPD-11020
- smiles:
- C(=O)([O-])C(=O)CC(O)CCl
- inchi key:
- InChIKey=FHWPHVIGZZAXIQ-VKHMYHEASA-M
- common name:
- 5-chloro-4-hydroxy-2-oxopentanoate
- molecular weight:
- 165.553
- Synonym(s):
- 5-chloro-4-hydroxy-2-oxovalerate
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- PUBCHEM:
"C(=O)([O-])C(=O)CC(O)CCl" cannot be used as a page name in this wiki.