Difference between revisions of "TRNA-URACIL-5--METHYLTRANSFERASE-RXN"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=COUMARATE COUMARATE] == * smiles: ** C(=O)([O-])C=CC1(=CC=C(O)C=C1) * inchi key: ** InChIKey=NG...") |
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=TRNA-URACIL-5--METHYLTRANSFERASE-RXN TRNA-URACIL-5--METHYLTRANSFERASE-RXN] == * direction: ** LEFT-...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Reaction]] |
− | == | + | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=TRNA-URACIL-5--METHYLTRANSFERASE-RXN TRNA-URACIL-5--METHYLTRANSFERASE-RXN] == |
− | + | * direction: | |
− | + | ** LEFT-TO-RIGHT | |
− | * | + | |
− | ** | + | |
* common name: | * common name: | ||
− | ** | + | ** S-adenosylmethionine-dependent tRNA (m5U54) methyltransferase |
− | * | + | * ec number: |
− | ** | + | ** [http://enzyme.expasy.org/EC/2.1.1.35 EC-2.1.1.35] |
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | == Reaction | + | == Reaction Formula == |
− | * [[ | + | * With identifiers: |
− | + | ** 1 [[Uracil-54-in-tRNA]][c] '''+''' 1 [[S-ADENOSYLMETHIONINE]][c] '''=>''' 1 [[tRNA-containing-5Me-uridine54]][c] '''+''' 1 [[ADENOSYL-HOMO-CYS]][c] '''+''' 1 [[PROTON]][c] | |
− | == | + | * With common name(s): |
+ | ** 1 a uracil54 in tRNA[c] '''+''' 1 S-adenosyl-L-methionine[c] '''=>''' 1 a 5-methyluracil54 in tRNA[c] '''+''' 1 S-adenosyl-L-homocysteine[c] '''+''' 1 H+[c] | ||
+ | |||
+ | == Genes associated with this reaction == | ||
+ | Genes have been associated with this reaction based on different elements listed below. | ||
+ | * Gene: [[Ec-06_000810]] | ||
+ | ** Source: [[annotation-esiliculosus_genome]] | ||
+ | *** Assignment: GO-TERM | ||
+ | == Pathways == | ||
+ | == Reconstruction information == | ||
+ | * Category: [[annotation]] | ||
+ | ** Source: [[annotation-esiliculosus_genome]] | ||
+ | *** Tool: [[pathwaytools]] | ||
== External links == | == External links == | ||
− | * | + | * LIGAND-RXN: |
− | + | ** [http://www.genome.jp/dbget-bin/www_bget?R00594 R00594] | |
− | ** [http:// | + | * UNIPROT: |
− | * | + | ** [http://www.uniprot.org/uniprot/P23003 P23003] |
− | * | + | ** [http://www.uniprot.org/uniprot/P31812 P31812] |
− | ** [http://www. | + | ** [http://www.uniprot.org/uniprot/Q9PP92 Q9PP92] |
− | + | ** [http://www.uniprot.org/uniprot/Q9JT82 Q9JT82] | |
− | ** [http://www. | + | {{#set: direction=LEFT-TO-RIGHT}} |
− | + | {{#set: common name=S-adenosylmethionine-dependent tRNA (m5U54) methyltransferase}} | |
− | ** [http://www. | + | {{#set: ec number=EC-2.1.1.35}} |
− | + | {{#set: gene associated=Ec-06_000810}} | |
− | {{#set: | + | {{#set: in pathway=}} |
− | {{#set: | + | {{#set: reconstruction category=annotation}} |
− | {{#set: | + | {{#set: reconstruction source=annotation-esiliculosus_genome}} |
− | {{#set: | + | {{#set: reconstruction tool=pathwaytools}} |
− | {{#set: | + | |
− | {{#set: | + |
Latest revision as of 19:42, 21 March 2018
Contents
Reaction TRNA-URACIL-5--METHYLTRANSFERASE-RXN
- direction:
- LEFT-TO-RIGHT
- common name:
- S-adenosylmethionine-dependent tRNA (m5U54) methyltransferase
- ec number:
- Synonym(s):
Reaction Formula
- With identifiers:
- 1 Uracil-54-in-tRNA[c] + 1 S-ADENOSYLMETHIONINE[c] => 1 tRNA-containing-5Me-uridine54[c] + 1 ADENOSYL-HOMO-CYS[c] + 1 PROTON[c]
- With common name(s):
- 1 a uracil54 in tRNA[c] + 1 S-adenosyl-L-methionine[c] => 1 a 5-methyluracil54 in tRNA[c] + 1 S-adenosyl-L-homocysteine[c] + 1 H+[c]
Genes associated with this reaction
Genes have been associated with this reaction based on different elements listed below.
- Gene: Ec-06_000810
- Source: annotation-esiliculosus_genome
- Assignment: GO-TERM
- Source: annotation-esiliculosus_genome
Pathways
Reconstruction information
- Category: annotation
- Source: annotation-esiliculosus_genome
- Tool: pathwaytools
- Source: annotation-esiliculosus_genome
External links