Difference between revisions of "Ec-02 006230"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12303 CPD-12303] == * smiles: ** CC(C)=CCCC(C)=CCCC(C)=CCCC(=CCCC(=CCCC(=CCCC(C)=CCCC(=CCCC...")
(Created page with "Category:Gene == Gene Ec-02_006230 == * left end position: ** 6343035 * transcription direction: ** NEGATIVE * right end position: ** 6349529 * centisome position: ** 97.1...")
 
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12303 CPD-12303] ==
+
== Gene Ec-02_006230 ==
−
* smiles:
+
* left end position:
−
** CC(C)=CCCC(C)=CCCC(C)=CCCC(=CCCC(=CCCC(=CCCC(C)=CCCC(=CCCC(=CCCC(=CCCC(=CCOP(OP([O-])(=O)OC1(C(NC(=O)C)C(OC(C)C(=O)NC(C)C(=O)NC(C(=O)[O-])CCC(=O)NC(CCCC[N+])C(NC(C)C(=O)[O-])=O)C(O)C(CO)O1))([O-])=O)C)C)C)C)C)C)C
+
** 6343035
−
* inchi key:
+
* transcription direction:
−
** InChIKey=KCROFJGXXSCHGA-YGMFIXCYSA-K
+
** NEGATIVE
−
* common name:
+
* right end position:
−
** undecaprenyl-diphospho-N-acetylmuramoyl-L-alanyl-γ-D-glutamyl-L-lysyl- D-alanine
+
** 6349529
−
* molecular weight:
+
* centisome position:
−
** 1598.955    
+
** 97.1697    
 
* Synonym(s):
 
* Synonym(s):
−
** mur2Ac(oyl-L-Ala-γ-D-Glu-L-Lys-D-Ala)-diphosphoundecaprenol
+
** Esi_0082_0115
−
** lipid I (tetrapeptide)
+
** Esi0082_0115
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
== Reaction(s) known to produce the compound ==
+
* Reaction: [[6.3.2.25-RXN]]
−
* [[RXN-11347]]
+
** Source: [[annotation-esiliculosus_genome]]
−
== Reaction(s) of unknown directionality ==
+
*** Assignment: automated-name-match
 +
== Pathways associated ==
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: left end position=6343035}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90657616 90657616]
+
{{#set: transcription direction=NEGATIVE}}
−
{{#set: smiles=CC(C)=CCCC(C)=CCCC(C)=CCCC(=CCCC(=CCCC(=CCCC(C)=CCCC(=CCCC(=CCCC(=CCCC(=CCOP(OP([O-])(=O)OC1(C(NC(=O)C)C(OC(C)C(=O)NC(C)C(=O)NC(C(=O)[O-])CCC(=O)NC(CCCC[N+])C(NC(C)C(=O)[O-])=O)C(O)C(CO)O1))([O-])=O)C)C)C)C)C)C)C}}
+
{{#set: right end position=6349529}}
−
{{#set: inchi key=InChIKey=KCROFJGXXSCHGA-YGMFIXCYSA-K}}
+
{{#set: centisome position=97.1697   }}
−
{{#set: common name=undecaprenyl-diphospho-N-acetylmuramoyl-L-alanyl-γ-D-glutamyl-L-lysyl- D-alanine}}
+
{{#set: common name=Esi_0082_0115|Esi0082_0115}}
−
{{#set: molecular weight=1598.955   }}
+
{{#set: reaction associated=6.3.2.25-RXN}}
−
{{#set: common name=mur2Ac(oyl-L-Ala-γ-D-Glu-L-Lys-D-Ala)-diphosphoundecaprenol|lipid I (tetrapeptide)}}
+
−
{{#set: produced by=RXN-11347}}
+

Latest revision as of 19:42, 21 March 2018

Gene Ec-02_006230

  • left end position:
    • 6343035
  • transcription direction:
    • NEGATIVE
  • right end position:
    • 6349529
  • centisome position:
    • 97.1697
  • Synonym(s):
    • Esi_0082_0115
    • Esi0082_0115

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=Ec-02_006230&oldid=28839"