Difference between revisions of "CPD-13910"
From metabolic_network
(Created page with "Category:Gene == Gene Ec-07_001290 == * Synonym(s): ** Esi_0045_0093 ** Esi0045_0093 ** COQ6 == Reactions associated == * Reaction: RXN-1121 ** Source: orthology-ar...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13910 CPD-13910] == * smiles: ** C1(OC(=O)C(=O)OC(C(O)C(=O)[O-])1) * inchi key: ** InChIKey...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13910 CPD-13910] == |
+ | * smiles: | ||
+ | ** C1(OC(=O)C(=O)OC(C(O)C(=O)[O-])1) | ||
+ | * inchi key: | ||
+ | ** InChIKey=FTDFTFXOJYXVTH-UHFFFAOYSA-M | ||
+ | * common name: | ||
+ | ** cyclic- 3,4-O-oxalyl-L-threonate | ||
+ | * molecular weight: | ||
+ | ** 189.101 | ||
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** 3,4-cyclic oxalyl theronolactone |
− | + | ||
− | + | ||
− | == | + | == Reaction(s) known to consume the compound == |
− | + | == Reaction(s) known to produce the compound == | |
− | * | + | * [[RXN-12872]] |
− | == | + | == Reaction(s) of unknown directionality == |
− | + | ||
== External links == | == External links == | ||
− | {{#set: common name= | + | * PUBCHEM: |
− | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90658084 90658084] |
− | {{#set: | + | {{#set: smiles=C1(OC(=O)C(=O)OC(C(O)C(=O)[O-])1)}} |
+ | {{#set: inchi key=InChIKey=FTDFTFXOJYXVTH-UHFFFAOYSA-M}} | ||
+ | {{#set: common name=cyclic- 3,4-O-oxalyl-L-threonate}} | ||
+ | {{#set: molecular weight=189.101 }} | ||
+ | {{#set: common name=3,4-cyclic oxalyl theronolactone}} | ||
+ | {{#set: produced by=RXN-12872}} |
Latest revision as of 19:42, 21 March 2018
Contents
Metabolite CPD-13910
- smiles:
- C1(OC(=O)C(=O)OC(C(O)C(=O)[O-])1)
- inchi key:
- InChIKey=FTDFTFXOJYXVTH-UHFFFAOYSA-M
- common name:
- cyclic- 3,4-O-oxalyl-L-threonate
- molecular weight:
- 189.101
- Synonym(s):
- 3,4-cyclic oxalyl theronolactone
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- PUBCHEM:
"C1(OC(=O)C(=O)OC(C(O)C(=O)[O-])1)" cannot be used as a page name in this wiki.