Difference between revisions of "CPD-13910"

Latest revision as of 19:42, 21 March 2018

"C1(OC(=O)C(=O)OC(C(O)C(=O)[O-])1)" cannot be used as a page name in this wiki.

@@ Line 1: / Line 1: @@
-[[Category:Gene]]
+[[Category:Metabolite]]
-== Gene Ec-07_001290 ==
+== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13910 CPD-13910] ==
+* smiles:
+** C1(OC(=O)C(=O)OC(C(O)C(=O)[O-])1)
+* inchi key:
+** InChIKey=FTDFTFXOJYXVTH-UHFFFAOYSA-M
+* common name:
+** cyclic- 3,4-O-oxalyl-L-threonate
+* molecular weight:
+** 189.101
 * Synonym(s):
-** Esi_0045_0093
+** 3,4-cyclic oxalyl theronolactone
-** Esi0045_0093
-** COQ6
-== Reactions associated ==
+== Reaction(s) known to consume the compound ==
-* Reaction: [[RXN-1121]]
+== Reaction(s) known to produce the compound ==
-** Source: [[orthology-aragem]]
+* [[RXN-12872]]
-== Pathways associated ==
+== Reaction(s) of unknown directionality ==
-* [[PWY-2181]]
 == External links  ==
-{{#set: common name=Esi_0045_0093|Esi0045_0093|COQ6}}
+* PUBCHEM:
-{{#set: reaction associated=RXN-1121}}
+** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90658084 90658084]
-{{#set: pathway associated=PWY-2181}}
+{{#set: smiles=C1(OC(=O)C(=O)OC(C(O)C(=O)[O-])1)}}
+{{#set: inchi key=InChIKey=FTDFTFXOJYXVTH-UHFFFAOYSA-M}}
+{{#set: common name=cyclic- 3,4-O-oxalyl-L-threonate}}
+{{#set: molecular weight=189.101    }}
+{{#set: common name=3,4-cyclic oxalyl theronolactone}}
+{{#set: produced by=RXN-12872}}