Difference between revisions of "RXN0-5514"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=ALPHA-GLUCOSE ALPHA-GLUCOSE] == * smiles: ** C(O)C1(OC(C(C(C1O)O)O)O) * inchi key: ** InChIKey=...")
 
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-6837 PWY-6837] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-33154 TAX-3...")
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Pathway]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=ALPHA-GLUCOSE ALPHA-GLUCOSE] ==
+
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-6837 PWY-6837] ==
* smiles:
+
* taxonomic range:
** C(O)C1(OC(C(C(C1O)O)O)O)
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-33154 TAX-33154]
* inchi key:
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-33090 TAX-33090]
** InChIKey=WQZGKKKJIJFFOK-DVKNGEFBSA-N
+
 
* common name:
 
* common name:
** α-D-glucopyranose
+
** fatty acid beta-oxidation V (unsaturated, odd number, di-isomerase-dependent)
* molecular weight:
+
** 180.157   
+
 
* Synonym(s):
 
* Synonym(s):
** α-glucose
 
** α-D-glucose
 
  
== Reaction(s) known to consume the compound ==
+
== Reaction(s) found ==
== Reaction(s) known to produce the compound ==
+
'''2''' reactions found over '''5''' reactions in the full pathway
* [[TREHALA-RXN]]
+
* [[RXN-12518]]
* [[3.2.1.58-RXN]]
+
** 3 associated gene(s):
== Reaction(s) of unknown directionality ==
+
*** [[Ec-22_002920]]
* [[ALDOSE-1-EPIMERASE-RXN]]
+
*** [[Ec-26_004320]]
 +
*** [[Ec-08_006390]]
 +
** 1 reconstruction source(s) associated:
 +
*** [[annotation-esiliculosus_genome]]
 +
* [[RXN-12521]]
 +
** 1 associated gene(s):
 +
*** [[Ec-16_003950]]
 +
** 1 reconstruction source(s) associated:
 +
*** [[annotation-esiliculosus_genome]]
 +
== Reaction(s) not found ==
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-12519 RXN-12519]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-12520 RXN-12520]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-7836 RXN-7836]
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
{{#set: taxonomic range=TAX-33154}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=79025 79025]
+
{{#set: taxonomic range=TAX-33090}}
* HMDB : HMDB03345
+
{{#set: common name=fatty acid beta-oxidation V (unsaturated, odd number, di-isomerase-dependent)}}
* LIGAND-CPD:
+
{{#set: reaction found=2}}
** [http://www.genome.jp/dbget-bin/www_bget?C00267 C00267]
+
{{#set: total reaction=5}}
* CHEMSPIDER:
+
{{#set: completion rate=40.0}}
** [http://www.chemspider.com/Chemical-Structure.71358.html 71358]
+
* CHEBI:
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=17925 17925]
+
* METABOLIGHTS : MTBLC17925
+
{{#set: smiles=C(O)C1(OC(C(C(C1O)O)O)O)}}
+
{{#set: inchi key=InChIKey=WQZGKKKJIJFFOK-DVKNGEFBSA-N}}
+
{{#set: common name=α-D-glucopyranose}}
+
{{#set: molecular weight=180.157    }}
+
{{#set: common name=α-glucose|α-D-glucose}}
+
{{#set: produced by=TREHALA-RXN|3.2.1.58-RXN}}
+
{{#set: consumed or produced by=ALDOSE-1-EPIMERASE-RXN}}
+

Revision as of 20:53, 17 March 2018

Pathway PWY-6837

  • taxonomic range:
  • common name:
    • fatty acid beta-oxidation V (unsaturated, odd number, di-isomerase-dependent)
  • Synonym(s):

Reaction(s) found

2 reactions found over 5 reactions in the full pathway

Reaction(s) not found

External links