Difference between revisions of "CPD-592"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=cis-21-CP-39-keto-40-Me-C60-ACPs cis-21-CP-39-keto-40-Me-C60-ACPs] == * common name: ** a cis-k...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-592 CPD-592] == * smiles: ** C([O-])(=O)CCCNC(=[N+])N * inchi key: ** InChIKey=TUHVEAJXIMEO...") |
||
| Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-592 CPD-592] == |
| + | * smiles: | ||
| + | ** C([O-])(=O)CCCNC(=[N+])N | ||
| + | * inchi key: | ||
| + | ** InChIKey=TUHVEAJXIMEOSA-UHFFFAOYSA-N | ||
* common name: | * common name: | ||
| − | ** | + | ** 4-guanidinobutanoate |
| + | * molecular weight: | ||
| + | ** 145.161 | ||
* Synonym(s): | * Synonym(s): | ||
| + | ** 4-guanido-butyrate | ||
| + | ** γ-guanidinobutyrate | ||
| + | ** 4-guanidinobutyrate | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| + | * [[GUANIDINOBUTYRASE-RXN]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[GUANIDINOBUTANAMIDE-NH3-RXN]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
| − | {{#set: common name= | + | * LIGAND-CPD: |
| − | {{#set: produced by= | + | ** [http://www.genome.jp/dbget-bin/www_bget?C01035 C01035] |
| + | * CHEBI: | ||
| + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57486 57486] | ||
| + | * METABOLIGHTS : MTBLC57486 | ||
| + | * PUBCHEM: | ||
| + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25200642 25200642] | ||
| + | * HMDB : HMDB03464 | ||
| + | {{#set: smiles=C([O-])(=O)CCCNC(=[N+])N}} | ||
| + | {{#set: inchi key=InChIKey=TUHVEAJXIMEOSA-UHFFFAOYSA-N}} | ||
| + | {{#set: common name=4-guanidinobutanoate}} | ||
| + | {{#set: molecular weight=145.161 }} | ||
| + | {{#set: common name=4-guanido-butyrate|γ-guanidinobutyrate|4-guanidinobutyrate}} | ||
| + | {{#set: consumed by=GUANIDINOBUTYRASE-RXN}} | ||
| + | {{#set: produced by=GUANIDINOBUTANAMIDE-NH3-RXN}} | ||
Latest revision as of 19:44, 21 March 2018
Contents
Metabolite CPD-592
- smiles:
- C([O-])(=O)CCCNC(=[N+])N
- inchi key:
- InChIKey=TUHVEAJXIMEOSA-UHFFFAOYSA-N
- common name:
- 4-guanidinobutanoate
- molecular weight:
- 145.161
- Synonym(s):
- 4-guanido-butyrate
- γ-guanidinobutyrate
- 4-guanidinobutyrate
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C([O-])(=O)CCCNC(=[N+])N" cannot be used as a page name in this wiki.
