Difference between revisions of "ALL-TRANS-HEPTAPRENYL-DIPHOSPHATE"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Carboxyadenylated-MPT-synthases Carboxyadenylated-MPT-synthases] == * common name: ** a carboxy...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=ALL-TRANS-HEPTAPRENYL-DIPHOSPHATE ALL-TRANS-HEPTAPRENYL-DIPHOSPHATE] == * smiles: ** CC(C)=CCCC...") |
||
| Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=ALL-TRANS-HEPTAPRENYL-DIPHOSPHATE ALL-TRANS-HEPTAPRENYL-DIPHOSPHATE] == |
| + | * smiles: | ||
| + | ** CC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCOP(=O)([O-])OP(=O)([O-])[O-] | ||
| + | * inchi key: | ||
| + | ** InChIKey=LSJLEXWXRKTZAJ-YUIIPXGZSA-K | ||
* common name: | * common name: | ||
| − | ** | + | ** all-trans-heptaprenyl diphosphate |
| + | * molecular weight: | ||
| + | ** 651.779 | ||
* Synonym(s): | * Synonym(s): | ||
| − | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[RXN- | + | * [[RXN-9222]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
| − | {{#set: | + | * PUBCHEM: |
| − | {{#set: common name= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25245257 25245257] |
| − | {{#set: | + | * CHEBI: |
| − | {{#set: | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58206 58206] |
| + | * LIGAND-CPD: | ||
| + | ** [http://www.genome.jp/dbget-bin/www_bget?C04216 C04216] | ||
| + | * HMDB : HMDB12187 | ||
| + | {{#set: smiles=CC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCOP(=O)([O-])OP(=O)([O-])[O-]}} | ||
| + | {{#set: inchi key=InChIKey=LSJLEXWXRKTZAJ-YUIIPXGZSA-K}} | ||
| + | {{#set: common name=all-trans-heptaprenyl diphosphate}} | ||
| + | {{#set: molecular weight=651.779 }} | ||
| + | {{#set: consumed by=RXN-9222}} | ||
Latest revision as of 19:44, 21 March 2018
Contents
Metabolite ALL-TRANS-HEPTAPRENYL-DIPHOSPHATE
- smiles:
- CC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCOP(=O)([O-])OP(=O)([O-])[O-]
- inchi key:
- InChIKey=LSJLEXWXRKTZAJ-YUIIPXGZSA-K
- common name:
- all-trans-heptaprenyl diphosphate
- molecular weight:
- 651.779
- Synonym(s):
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCOP(=O)([O-])OP(=O)([O-])[O-" cannot be used as a page name in this wiki.
