Difference between revisions of "Ec-15 000530"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=PORPHOBILINOGEN PORPHOBILINOGEN] == * smiles: ** C(C1(=C(C(=CN1)CCC(=O)[O-])CC(=O)[O-]))[N+] *...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=24-26-N-linked-Glycan 24-26-N-linked-Glycan] == * common name: ** [(2,4),(2,6)]-N-linked glycan...") |
||
Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=24-26-N-linked-Glycan 24-26-N-linked-Glycan] == |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
* common name: | * common name: | ||
− | ** | + | ** [(2,4),(2,6)]-N-linked glycan |
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[ | + | * [[2.4.1.201-RXN]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[ | + | * [[2.4.1.155-RXN]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
− | + | {{#set: common name=[(2,4),(2,6)]-N-linked glycan}} | |
− | + | {{#set: consumed by=2.4.1.201-RXN}} | |
− | + | {{#set: produced by=2.4.1.155-RXN}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | + | ||
− | + | ||
− | + | ||
− | {{#set: consumed by= | + | |
− | {{#set: produced by= | + |
Revision as of 20:53, 17 March 2018
Contents
Metabolite 24-26-N-linked-Glycan
- common name:
- [(2,4),(2,6)]-N-linked glycan
- Synonym(s):
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"(2,4),(2,6)]-N-linked glycan" cannot be used as a page name in this wiki.