Difference between revisions of "Ec-13 002660"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-16618 CPD-16618] == * smiles: ** C(C(=O)[O-])C(O)[CH]=O * inchi key: ** InChIKey=QWHDXIUUXW...")
(Created page with "Category:Gene == Gene Ec-13_002660 == * left end position: ** 4360910 * transcription direction: ** POSITIVE * right end position: ** 4362118 * centisome position: ** 62.8...")
 
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-16618 CPD-16618] ==
+
== Gene Ec-13_002660 ==
−
* smiles:
+
* left end position:
−
** C(C(=O)[O-])C(O)[CH]=O
+
** 4360910
−
* inchi key:
+
* transcription direction:
−
** InChIKey=QWHDXIUUXWGQME-GSVOUGTGSA-M
+
** POSITIVE
−
* common name:
+
* right end position:
−
** L-malic semialdehyde
+
** 4362118
−
* molecular weight:
+
* centisome position:
−
** 117.081    
+
** 62.87114    
 
* Synonym(s):
 
* Synonym(s):
−
** (3R)-3-hydroxy-4-oxobutanoate
+
** Esi_0560_0001
 +
** Esi0560_0001
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
* [[RXN-6002]]
+
* Reaction: [[UBIQUITIN--PROTEIN-LIGASE-RXN]]
−
== Reaction(s) known to produce the compound ==
+
** Source: [[annotation-esiliculosus_genome]]
−
== Reaction(s) of unknown directionality ==
+
*** Assignment: go-term
 +
== Pathways associated ==
 +
* [[PWY-7511]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: left end position=4360910}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90658049 90658049]
+
{{#set: transcription direction=POSITIVE}}
−
{{#set: smiles=C(C(=O)[O-])C(O)[CH]=O}}
+
{{#set: right end position=4362118}}
−
{{#set: inchi key=InChIKey=QWHDXIUUXWGQME-GSVOUGTGSA-M}}
+
{{#set: centisome position=62.87114   }}
−
{{#set: common name=L-malic semialdehyde}}
+
{{#set: common name=Esi_0560_0001|Esi0560_0001}}
−
{{#set: molecular weight=117.081   }}
+
{{#set: reaction associated=UBIQUITIN--PROTEIN-LIGASE-RXN}}
−
{{#set: common name=(3R)-3-hydroxy-4-oxobutanoate}}
+
{{#set: pathway associated=PWY-7511}}
−
{{#set: consumed by=RXN-6002}}
+

Latest revision as of 19:45, 21 March 2018

Gene Ec-13_002660

  • left end position:
    • 4360910
  • transcription direction:
    • POSITIVE
  • right end position:
    • 4362118
  • centisome position:
    • 62.87114
  • Synonym(s):
    • Esi_0560_0001
    • Esi0560_0001

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=Ec-13_002660&oldid=29107"