Difference between revisions of "PWY-5938"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=ISPH2-RXN ISPH2-RXN] == * direction: ** LEFT-TO-RIGHT * common name: ** 4-hydroxy-3-methylbut-2-eny...")
 
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-706 CPD-706] == * smiles: ** CC(C)C(=C)CCC(C)[CH]3(CC[CH]4([CH]2(CC=C1(CC(O)CCC(C)1[CH]2CCC...")
Line 1: Line 1:
−
[[Category:Reaction]]
+
[[Category:Metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=ISPH2-RXN ISPH2-RXN] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-706 CPD-706] ==
−
* direction:
+
* smiles:
−
** LEFT-TO-RIGHT
+
** CC(C)C(=C)CCC(C)[CH]3(CC[CH]4([CH]2(CC=C1(CC(O)CCC(C)1[CH]2CCC(C)34))))
 +
* inchi key:
 +
** InChIKey=INDVLXYUCBVVKW-PXBBAZSNSA-N
 
* common name:
 
* common name:
−
** 4-hydroxy-3-methylbut-2-enyl diphosphate reductase
+
** 24-methylenecholesterol
−
* ec number:
+
* molecular weight:
−
** [http://enzyme.expasy.org/EC/1.17.7.4 EC-1.17.7.4]
+
** 398.671   
 
* Synonym(s):
 
* Synonym(s):
  
−
== Reaction Formula ==
+
== Reaction(s) known to consume the compound ==
−
* With identifiers:
+
== Reaction(s) known to produce the compound ==
−
** 2 [[Reduced-ferredoxins]][c] '''+''' 1 [[HYDROXY-METHYL-BUTENYL-DIP]][c] '''+''' 2 [[PROTON]][c] '''=>''' 2 [[Oxidized-ferredoxins]][c] '''+''' 1 [[WATER]][c] '''+''' 1 [[DELTA3-ISOPENTENYL-PP]][c]
+
* [[RXN-707]]
−
* With common name(s):
+
== Reaction(s) of unknown directionality ==
−
** 2 a reduced ferredoxin [iron-sulfur] cluster[c] '''+''' 1 (E)-4-hydroxy-3-methylbut-2-en-1-yl diphosphate[c] '''+''' 2 H+[c] '''=>''' 2 an oxidized ferredoxin [iron-sulfur] cluster[c] '''+''' 1 H2O[c] '''+''' 1 isopentenyl diphosphate[c]
+
−
 
+
−
== Genes associated with this reaction  ==
+
−
Genes have been associated with this reaction based on different elements listed below.
+
−
* [[Ec-06_002680]]
+
−
** ESILICULOSUS_GENOME
+
−
***EC-NUMBER
+
−
** [[pantograph]]-[[aragem]]
+
−
== Pathways  ==
+
−
* [[NONMEVIPP-PWY]], methylerythritol phosphate pathway I: [http://metacyc.org/META/NEW-IMAGE?object=NONMEVIPP-PWY NONMEVIPP-PWY]
+
−
** '''8''' reactions found over '''9''' reactions in the full pathway
+
−
* [[PWY-7560]], methylerythritol phosphate pathway II: [http://metacyc.org/META/NEW-IMAGE?object=PWY-7560 PWY-7560]
+
−
** '''9''' reactions found over '''9''' reactions in the full pathway
+
−
== Reconstruction information  ==
+
−
* [[orthology]]:
+
−
** [[pantograph]]:
+
−
*** [[aragem]]
+
−
* [[annotation]]:
+
−
** [[pathwaytools]]:
+
−
*** [[esiliculosus_genome]]
+
 
== External links  ==
 
== External links  ==
−
* LIGAND-RXN:
+
* PUBCHEM:
−
** [http://www.genome.jp/dbget-bin/www_bget?R08209 R08209]
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=23724573 23724573]
−
** [http://www.genome.jp/dbget-bin/www_bget?R05884 R05884]
+
* LIGAND-CPD:
−
{{#set: direction=LEFT-TO-RIGHT}}
+
** [http://www.genome.jp/dbget-bin/www_bget?C15781 C15781]
−
{{#set: common name=4-hydroxy-3-methylbut-2-enyl diphosphate reductase}}
+
* HMDB : HMDB06849
−
{{#set: ec number=EC-1.17.7.4}}
+
{{#set: smiles=CC(C)C(=C)CCC(C)[CH]3(CC[CH]4([CH]2(CC=C1(CC(O)CCC(C)1[CH]2CCC(C)34))))}}
−
{{#set: gene associated=Ec-06_002680}}
+
{{#set: inchi key=InChIKey=INDVLXYUCBVVKW-PXBBAZSNSA-N}}
−
{{#set: in pathway=NONMEVIPP-PWY|PWY-7560}}
+
{{#set: common name=24-methylenecholesterol}}
−
{{#set: reconstruction category=orthology}}
+
{{#set: molecular weight=398.671    }}
−
{{#set: reconstruction tool=pantograph}}
+
{{#set: produced by=RXN-707}}
−
{{#set: reconstruction source=aragem}}
+
−
{{#set: reconstruction category=annotation}}
+
−
{{#set: reconstruction tool=pathwaytools}}
+
−
{{#set: reconstruction source=esiliculosus_genome}}
+

Revision as of 20:53, 17 March 2018

Metabolite CPD-706

  • smiles:
    • CC(C)C(=C)CCC(C)[CH]3(CC[CH]4([CH]2(CC=C1(CC(O)CCC(C)1[CH]2CCC(C)34))))
  • inchi key:
    • InChIKey=INDVLXYUCBVVKW-PXBBAZSNSA-N
  • common name:
    • 24-methylenecholesterol
  • molecular weight:
    • 398.671
  • Synonym(s):

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"CC(C)C(=C)CCC(C)[CH]3(CC[CH]4([CH]2(CC=C1(CC(O)CCC(C)1[CH]2CCC(C)34))))" cannot be used as a page name in this wiki.



Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=PWY-5938&oldid=10760"