Difference between revisions of "Ec-00 007360"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-18761 CPD-18761] == * smiles: ** COC1(=CC(=CCCO)C=CC(=O)1) * inchi key: ** InChIKey=ORAJWSY...")
(Created page with "Category:Gene == Gene Ec-00_007360 == * left end position: ** 11799898 * transcription direction: ** POSITIVE * right end position: ** 11800074 * centisome position: ** 62...")
 
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-18761 CPD-18761] ==
+
== Gene Ec-00_007360 ==
−
* smiles:
+
* left end position:
−
** COC1(=CC(=CCCO)C=CC(=O)1)
+
** 11799898
−
* inchi key:
+
* transcription direction:
−
** InChIKey=ORAJWSYKRGVTDP-UHFFFAOYSA-N
+
** POSITIVE
−
* common name:
+
* right end position:
−
** coniferyl alcohol radical
+
** 11800074
−
* molecular weight:
+
* centisome position:
−
** 179.195    
+
** 62.280315    
 
* Synonym(s):
 
* Synonym(s):
 +
** Esi_0552_0016
 +
** Esi0552_0016
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
== Reaction(s) known to produce the compound ==
+
* Reaction: [[2.5.1.39-RXN]]
−
* [[RXN-17352]]
+
** Source: [[annotation-esiliculosus_genome]]
−
== Reaction(s) of unknown directionality ==
+
*** Assignment: automated-name-match
 +
* Reaction: [[4OHBENZOATE-OCTAPRENYLTRANSFER-RXN]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: automated-name-match
 +
* Reaction: [[RXN-11368]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: automated-name-match
 +
* Reaction: [[RXN-9003]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: automated-name-match
 +
* Reaction: [[RXN-9222]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: automated-name-match
 +
* Reaction: [[RXN-9230]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: automated-name-match
 +
== Pathways associated ==
 +
* [[PWY3O-19]]
 +
* [[PWY-6978]]
 +
* [[PWY-7235]]
 +
* [[PWY-6708]]
 +
* [[PWY-5855]]
 +
* [[PWY-5857]]
 +
* [[PWY-5856]]
 +
* [[PWY-5873]]
 +
* [[PWY-5872]]
 +
* [[PWY-5871]]
 +
* [[PWY-5870]]
 
== External links  ==
 
== External links  ==
−
{{#set: smiles=COC1(=CC(=CCCO)C=CC(=O)1)}}
+
{{#set: left end position=11799898}}
−
{{#set: inchi key=InChIKey=ORAJWSYKRGVTDP-UHFFFAOYSA-N}}
+
{{#set: transcription direction=POSITIVE}}
−
{{#set: common name=coniferyl alcohol radical}}
+
{{#set: right end position=11800074}}
−
{{#set: molecular weight=179.195    }}
+
{{#set: centisome position=62.280315    }}
−
{{#set: produced by=RXN-17352}}
+
{{#set: common name=Esi_0552_0016|Esi0552_0016}}
 +
{{#set: reaction associated=2.5.1.39-RXN|4OHBENZOATE-OCTAPRENYLTRANSFER-RXN|RXN-11368|RXN-9003|RXN-9222|RXN-9230}}
 +
{{#set: pathway associated=PWY3O-19|PWY-6978|PWY-7235|PWY-6708|PWY-5855|PWY-5857|PWY-5856|PWY-5873|PWY-5872|PWY-5871|PWY-5870}}

Latest revision as of 19:46, 21 March 2018

Gene Ec-00_007360

  • left end position:
    • 11799898
  • transcription direction:
    • POSITIVE
  • right end position:
    • 11800074
  • centisome position:
    • 62.280315
  • Synonym(s):
    • Esi_0552_0016
    • Esi0552_0016

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=Ec-00_007360&oldid=29160"