Difference between revisions of "BIOMASS"

Latest revision as of 19:46, 21 March 2018

@@ Line 1: / Line 1: @@
 [[Category:Metabolite]]
-== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-18666 CPD-18666] ==
+== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=BIOMASS BIOMASS] ==
-* smiles:
-** CCC1(=C(C)C3(=NC1=CC6(=C(C)C7(C(=O)[C-](C(OC)=O)C(=C2(C(CCC(=O)[O-])C(C)C(=N2)C=C5(C(C)=C(C=C)C4(OC34)(N5))))C(N6)=7))))
-* inchi key:
-** InChIKey=ZMTPZDVBGYNPLZ-YGOWEZGDSA-M
-* common name:
-** epoxypheophorbide a
-* molecular weight:
-** 606.677
 * Synonym(s):
 == Reaction(s) known to consume the compound ==
-* [[RXN-17253]]
+* [[Exchange_BIOMASS]]
+* [[Transport_BIOMASS]]
 == Reaction(s) known to produce the compound ==
-* [[RXN-17252]]
+* [[Exchange_BIOMASS]]
+* [[Transport_BIOMASS]]
+* [[biomass_rxn]]
 == Reaction(s) of unknown directionality ==
 == External links  ==
-{{#set: smiles=CCC1(=C(C)C3(=NC1=CC6(=C(C)C7(C(=O)[C-](C(OC)=O)C(=C2(C(CCC(=O)[O-])C(C)C(=N2)C=C5(C(C)=C(C=C)C4(OC34)(N5))))C(N6)=7))))}}
+{{#set: consumed by=Exchange_BIOMASS|Transport_BIOMASS}}
-{{#set: inchi key=InChIKey=ZMTPZDVBGYNPLZ-YGOWEZGDSA-M}}
+{{#set: produced by=Exchange_BIOMASS|Transport_BIOMASS|biomass_rxn}}
-{{#set: common name=epoxypheophorbide a}}
-{{#set: molecular weight=606.677    }}
-{{#set: consumed by=RXN-17253}}
-{{#set: produced by=RXN-17252}}