Difference between revisions of "BCCP-dimers"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=P-AMINO-BENZOATE P-AMINO-BENZOATE] == * smiles: ** C(=O)([O-])C1(C=CC(=CC=1)N) * inchi key: **...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=BCCP-dimers BCCP-dimers] == * common name: ** a biotinylated [BCCP dimer] * Synonym(s): ** a bi...") |
||
| Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=BCCP-dimers BCCP-dimers] == |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
* common name: | * common name: | ||
| − | ** | + | ** a biotinylated [BCCP dimer] |
| − | + | ||
| − | + | ||
* Synonym(s): | * Synonym(s): | ||
| − | ** | + | ** a biotinylated [biotin-carboxy-carrier-protein dimer] |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| + | * [[RXN-7101]] | ||
| + | * [[RXN0-5055]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | |||
== External links == | == External links == | ||
| − | + | {{#set: common name=a biotinylated [BCCP dimer]}} | |
| − | + | {{#set: common name=a biotinylated [biotin-carboxy-carrier-protein dimer]}} | |
| − | + | {{#set: produced by=RXN-7101|RXN0-5055}} | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | {{#set: | + | |
| − | + | ||
| − | {{#set: common name= | + | |
| − | + | ||
| − | + | ||
| − | {{#set: | + | |
| − | + | ||
Latest revision as of 19:46, 21 March 2018
Contents
Metabolite BCCP-dimers
- common name:
- a biotinylated [BCCP dimer]
- Synonym(s):
- a biotinylated [biotin-carboxy-carrier-protein dimer]
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"a biotinylated [BCCP dimer" cannot be used as a page name in this wiki.
"a biotinylated [biotin-carboxy-carrier-protein dimer" cannot be used as a page name in this wiki.
