Difference between revisions of "Ec-27 001550"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-19144 CPD-19144] == * smiles: ** CCCCCCCCC=CCCCCCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(O...")
(Created page with "Category:Gene == Gene Ec-27_001550 == * left end position: ** 1290930 * transcription direction: ** POSITIVE * right end position: ** 1317155 * centisome position: ** 20.0...")
 
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-19144 CPD-19144] ==
+
== Gene Ec-27_001550 ==
−
* smiles:
+
* left end position:
−
** CCCCCCCCC=CCCCCCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
+
** 1290930
−
* inchi key:
+
* transcription direction:
−
** InChIKey=MJWMOLDKMBISOB-YDGGZUKGSA-J
+
** POSITIVE
−
* common name:
+
* right end position:
−
** (7Z)-hexadecenoyl-CoA
+
** 1317155
−
* molecular weight:
+
* centisome position:
−
** 999.899    
+
** 20.014708    
 
* Synonym(s):
 
* Synonym(s):
−
** cis-hexadec-7-enoyl-CoA
+
** Esi_0366_0019
−
** (7Z)-hexadec-7-enoyl-CoA
+
** Esi0366_0019
−
** 16:1 cis-7
+
−
** 16:1(n-9)
+
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
* [[RXN-17779]]
+
* Reaction: [[ATPASE-RXN]]
−
== Reaction(s) known to produce the compound ==
+
** Source: [[annotation-esiliculosus_genome]]
−
== Reaction(s) of unknown directionality ==
+
*** Assignment: go-term
 +
== Pathways associated ==
 
== External links  ==
 
== External links  ==
−
{{#set: smiles=CCCCCCCCC=CCCCCCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]}}
+
{{#set: left end position=1290930}}
−
{{#set: inchi key=InChIKey=MJWMOLDKMBISOB-YDGGZUKGSA-J}}
+
{{#set: transcription direction=POSITIVE}}
−
{{#set: common name=(7Z)-hexadecenoyl-CoA}}
+
{{#set: right end position=1317155}}
−
{{#set: molecular weight=999.899   }}
+
{{#set: centisome position=20.014708   }}
−
{{#set: common name=cis-hexadec-7-enoyl-CoA|(7Z)-hexadec-7-enoyl-CoA|16:1 cis-7|16:1(n-9)}}
+
{{#set: common name=Esi_0366_0019|Esi0366_0019}}
−
{{#set: consumed by=RXN-17779}}
+
{{#set: reaction associated=ATPASE-RXN}}

Latest revision as of 19:47, 21 March 2018

Gene Ec-27_001550

  • left end position:
    • 1290930
  • transcription direction:
    • POSITIVE
  • right end position:
    • 1317155
  • centisome position:
    • 20.014708
  • Synonym(s):
    • Esi_0366_0019
    • Esi0366_0019

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=Ec-27_001550&oldid=29256"