Difference between revisions of "L-methionyl-tRNAfmet"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-308 CPD-308] == * smiles: ** C([O-])(=O)CCC([N+]C(C(=O)[O-])CCCNC(N)=[N+])C([O-])=O * inchi...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=L-methionyl-tRNAfmet L-methionyl-tRNAfmet] == * common name: ** an L-methionyl-[initiator tRNAm...") |
||
| Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=L-methionyl-tRNAfmet L-methionyl-tRNAfmet] == |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
* common name: | * common name: | ||
| − | ** | + | ** an L-methionyl-[initiator tRNAmet] |
| − | + | ||
| − | + | ||
* Synonym(s): | * Synonym(s): | ||
| − | ** | + | ** an L-methionyl-tRNAfmet |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| + | * [[METHIONYL-TRNA-FORMYLTRANSFERASE-RXN]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[RXN-16165]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
| − | + | {{#set: common name=an L-methionyl-[initiator tRNAmet]}} | |
| − | + | {{#set: common name=an L-methionyl-tRNAfmet}} | |
| − | + | {{#set: consumed by=METHIONYL-TRNA-FORMYLTRANSFERASE-RXN}} | |
| − | + | {{#set: produced by=RXN-16165}} | |
| − | + | ||
| − | + | ||
| − | {{#set: | + | |
| − | + | ||
| − | {{#set: common name= | + | |
| − | {{#set: | + | |
| − | + | ||
| − | {{#set: produced by= | + | |
Latest revision as of 19:47, 21 March 2018
Contents
Metabolite L-methionyl-tRNAfmet
- common name:
- an L-methionyl-[initiator tRNAmet]
- Synonym(s):
- an L-methionyl-tRNAfmet
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"an L-methionyl-[initiator tRNAmet" cannot be used as a page name in this wiki.
