Difference between revisions of "C1"
From metabolic_network
(Created page with "Category:Gene == Gene Ec-08_000860 == * left end position: ** 851507 * transcription direction: ** NEGATIVE * right end position: ** 864783 * centisome position: ** 12.714...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=C1 C1] == * smiles: ** CC(C(=O)NC(C)C([O-])=O)NC(=O)C(CCCC([N+])C(=O)[O-])NC(=O)CCC(C(=O)[O-])N...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=C1 C1] == |
− | * | + | * smiles: |
− | ** | + | ** CC(C(=O)NC(C)C([O-])=O)NC(=O)C(CCCC([N+])C(=O)[O-])NC(=O)CCC(C(=O)[O-])NC(=O)C(C)NC(=O)C(C)OC1(C(O)C(CO)OC(C(NC(=O)C)1)OP([O-])(OP([O-])(OCC2(C(O)C(O)C(O2)N3(C=CC(=O)NC(=O)3)))=O)=O) |
− | * | + | * inchi key: |
− | ** | + | ** InChIKey=IMWOXEZVYQDRDF-MCZXNMLPSA-J |
− | * | + | * common name: |
− | ** | + | ** UDP-N-acetyl-α-D-muramoyl-L-alanyl-γ-D-glutamyl-meso-2,6-diaminopimeloyl-D-alanyl-D-alanine |
− | * | + | * molecular weight: |
− | ** | + | ** 1189.924 |
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** UDP-N-acetylmuramoyl-L-alanyl-γ-D-glutamyl-meso-2,6-diaminopimeloyl-D-alanyl-D-alanine |
− | ** | + | ** UDP-N-acetylmuramoyl-L-alanyl-γ-D-glutamyl-meso-2,6-diaminoheptanedioate- D-alanyl-D-alanine |
− | == | + | == Reaction(s) known to consume the compound == |
− | * | + | * [[PHOSNACMURPENTATRANS-RXN]] |
− | + | == Reaction(s) known to produce the compound == | |
− | + | == Reaction(s) of unknown directionality == | |
− | + | ||
− | + | ||
− | + | ||
− | == | + | |
− | + | ||
== External links == | == External links == | ||
− | {{#set: | + | * PUBCHEM: |
− | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25244658 25244658] |
− | {{#set: | + | * CHEBI: |
− | {{#set: | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=61386 61386] |
− | {{#set: common name= | + | * BIGG : 44801 |
− | + | * LIGAND-CPD: | |
− | {{#set: | + | ** [http://www.genome.jp/dbget-bin/www_bget?C04882 C04882] |
+ | {{#set: smiles=CC(C(=O)NC(C)C([O-])=O)NC(=O)C(CCCC([N+])C(=O)[O-])NC(=O)CCC(C(=O)[O-])NC(=O)C(C)NC(=O)C(C)OC1(C(O)C(CO)OC(C(NC(=O)C)1)OP([O-])(OP([O-])(OCC2(C(O)C(O)C(O2)N3(C=CC(=O)NC(=O)3)))=O)=O)}} | ||
+ | {{#set: inchi key=InChIKey=IMWOXEZVYQDRDF-MCZXNMLPSA-J}} | ||
+ | {{#set: common name=UDP-N-acetyl-α-D-muramoyl-L-alanyl-γ-D-glutamyl-meso-2,6-diaminopimeloyl-D-alanyl-D-alanine}} | ||
+ | {{#set: molecular weight=1189.924 }} | ||
+ | {{#set: common name=UDP-N-acetylmuramoyl-L-alanyl-γ-D-glutamyl-meso-2,6-diaminopimeloyl-D-alanyl-D-alanine|UDP-N-acetylmuramoyl-L-alanyl-γ-D-glutamyl-meso-2,6-diaminoheptanedioate- D-alanyl-D-alanine}} | ||
+ | {{#set: consumed by=PHOSNACMURPENTATRANS-RXN}} |
Latest revision as of 19:47, 21 March 2018
Contents
Metabolite C1
- smiles:
- CC(C(=O)NC(C)C([O-])=O)NC(=O)C(CCCC([N+])C(=O)[O-])NC(=O)CCC(C(=O)[O-])NC(=O)C(C)NC(=O)C(C)OC1(C(O)C(CO)OC(C(NC(=O)C)1)OP([O-])(OP([O-])(OCC2(C(O)C(O)C(O2)N3(C=CC(=O)NC(=O)3)))=O)=O)
- inchi key:
- InChIKey=IMWOXEZVYQDRDF-MCZXNMLPSA-J
- common name:
- UDP-N-acetyl-α-D-muramoyl-L-alanyl-γ-D-glutamyl-meso-2,6-diaminopimeloyl-D-alanyl-D-alanine
- molecular weight:
- 1189.924
- Synonym(s):
- UDP-N-acetylmuramoyl-L-alanyl-γ-D-glutamyl-meso-2,6-diaminopimeloyl-D-alanyl-D-alanine
- UDP-N-acetylmuramoyl-L-alanyl-γ-D-glutamyl-meso-2,6-diaminoheptanedioate- D-alanyl-D-alanine
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CC(C(=O)NC(C)C([O-])=O)NC(=O)C(CCCC([N+])C(=O)[O-])NC(=O)CCC(C(=O)[O-])NC(=O)C(C)NC(=O)C(C)OC1(C(O)C(CO)OC(C(NC(=O)C)1)OP([O-])(OP([O-])(OCC2(C(O)C(O)C(O2)N3(C=CC(=O)NC(=O)3)))=O)=O)" cannot be used as a page name in this wiki.