Difference between revisions of "CPD-695"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DIHYDROXY-BUTANONE-P DIHYDROXY-BUTANONE-P] == * smiles: ** CC(=O)C(O)COP(=O)([O-])[O-] * inchi...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-695 CPD-695] == * smiles: ** C=C1(C2(O)(CC3(C1)(C([CH]4(C(C)(CCCC(C)([CH](CC2)3)4)C([O-])=O...") |
||
Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-695 CPD-695] == |
* smiles: | * smiles: | ||
− | ** | + | ** C=C1(C2(O)(CC3(C1)(C([CH]4(C(C)(CCCC(C)([CH](CC2)3)4)C([O-])=O))C([O-])=O))) |
* inchi key: | * inchi key: | ||
− | ** InChIKey= | + | ** InChIKey=CZEMYYICWZPENF-VOLTXKGXSA-L |
* common name: | * common name: | ||
− | ** | + | ** gibberellin A53 |
* molecular weight: | * molecular weight: | ||
− | ** | + | ** 346.422 |
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** GA53 |
− | + | ||
− | + | ||
− | + | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[ | + | * [[RXN1F-167]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
* PUBCHEM: | * PUBCHEM: | ||
− | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25203620 25203620] |
− | + | ||
− | + | ||
* CHEBI: | * CHEBI: | ||
− | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId= | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=27433 27433] |
− | + | ||
* LIGAND-CPD: | * LIGAND-CPD: | ||
− | ** [http://www.genome.jp/dbget-bin/www_bget? | + | ** [http://www.genome.jp/dbget-bin/www_bget?C06094 C06094] |
− | {{#set: smiles= | + | * HMDB : HMDB36895 |
− | {{#set: inchi key=InChIKey= | + | {{#set: smiles=C=C1(C2(O)(CC3(C1)(C([CH]4(C(C)(CCCC(C)([CH](CC2)3)4)C([O-])=O))C([O-])=O)))}} |
− | {{#set: common name= | + | {{#set: inchi key=InChIKey=CZEMYYICWZPENF-VOLTXKGXSA-L}} |
− | {{#set: molecular weight= | + | {{#set: common name=gibberellin A53}} |
− | {{#set: common name= | + | {{#set: molecular weight=346.422 }} |
− | {{#set: consumed by= | + | {{#set: common name=GA53}} |
− | + | {{#set: consumed by=RXN1F-167}} |
Latest revision as of 20:48, 21 March 2018
Contents
Metabolite CPD-695
- smiles:
- C=C1(C2(O)(CC3(C1)(C([CH]4(C(C)(CCCC(C)([CH](CC2)3)4)C([O-])=O))C([O-])=O)))
- inchi key:
- InChIKey=CZEMYYICWZPENF-VOLTXKGXSA-L
- common name:
- gibberellin A53
- molecular weight:
- 346.422
- Synonym(s):
- GA53
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C=C1(C2(O)(CC3(C1)(C([CH]4(C(C)(CCCC(C)([CH](CC2)3)4)C([O-])=O))C([O-])=O)))" cannot be used as a page name in this wiki.