Difference between revisions of "PWY-7184"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CDP-CHOLINE CDP-CHOLINE] == * smiles: ** C[N+](C)(C)CCOP([O-])(=O)OP([O-])(=O)OCC1(OC(C(O)C(O)1...")
 
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-7184 PWY-7184] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2157 TAX-21...")
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Pathway]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CDP-CHOLINE CDP-CHOLINE] ==
+
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-7184 PWY-7184] ==
−
* smiles:
+
* taxonomic range:
−
** C[N+](C)(C)CCOP([O-])(=O)OP([O-])(=O)OCC1(OC(C(O)C(O)1)N2(C=CC(=NC2=O)N))
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2157 TAX-2157]
−
* inchi key:
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2759 TAX-2759]
−
** InChIKey=RZZPDXZPRHQOCG-OJAKKHQRSA-M
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2]
 
* common name:
 
* common name:
−
** CDP-choline
+
** pyrimidine deoxyribonucleotides de novo biosynthesis I
−
* molecular weight:
+
−
** 487.319   
+
 
* Synonym(s):
 
* Synonym(s):
−
** citicoline
 
−
** citicholine
 
−
** cidifos
 
−
** cyticholine
 
−
** cytidine 5'-diphosphocholine
 
−
** cytidine diphosphate choline
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction(s) found ==
−
== Reaction(s) known to produce the compound ==
+
'''9''' reactions found over '''9''' reactions in the full pathway
−
* [[2.7.7.15-RXN]]
+
* [[CDPREDUCT-RXN]]
−
== Reaction(s) of unknown directionality ==
+
** 7 associated gene(s):
−
* [[RXN-5781]]
+
*** [[Ec-06_005120]]
 +
*** [[Ec-11_002170]]
 +
*** [[Ec-19_000440]]
 +
*** [[Ec-11_002180]]
 +
*** [[Ec-21_002920]]
 +
*** [[Ec-17_003700]]
 +
*** [[Ec-06_005570]]
 +
** 2 reconstruction source(s) associated:
 +
*** [[annotation-esiliculosus_genome]]
 +
*** [[orthology-aragem]]
 +
* [[DCDPKIN-RXN]]
 +
** 7 associated gene(s):
 +
*** [[Ec-04_001140]]
 +
*** [[Ec-11_005170]]
 +
*** [[Ec-03_001380]]
 +
*** [[Ec-26_003930]]
 +
*** [[Ec-07_000140]]
 +
*** [[Ec-22_003280]]
 +
*** [[Ec-11_004330]]
 +
** 2 reconstruction source(s) associated:
 +
*** [[annotation-esiliculosus_genome]]
 +
*** [[orthology-aragem]]
 +
* [[DTDPKIN-RXN]]
 +
** 7 associated gene(s):
 +
*** [[Ec-26_003930]]
 +
*** [[Ec-04_001140]]
 +
*** [[Ec-11_004330]]
 +
*** [[Ec-22_003280]]
 +
*** [[Ec-11_005170]]
 +
*** [[Ec-03_001380]]
 +
*** [[Ec-07_000140]]
 +
** 2 reconstruction source(s) associated:
 +
*** [[annotation-esiliculosus_genome]]
 +
*** [[orthology-aragem]]
 +
* [[DTMPKI-RXN]]
 +
** 1 associated gene(s):
 +
*** [[Ec-20_004950]]
 +
** 1 reconstruction source(s) associated:
 +
*** [[annotation-esiliculosus_genome]]
 +
* [[DUDPKIN-RXN]]
 +
** 7 associated gene(s):
 +
*** [[Ec-11_005170]]
 +
*** [[Ec-11_004330]]
 +
*** [[Ec-03_001380]]
 +
*** [[Ec-04_001140]]
 +
*** [[Ec-07_000140]]
 +
*** [[Ec-22_003280]]
 +
*** [[Ec-26_003930]]
 +
** 2 reconstruction source(s) associated:
 +
*** [[annotation-esiliculosus_genome]]
 +
*** [[orthology-aragem]]
 +
* [[DUTP-PYROP-RXN]]
 +
** 1 associated gene(s):
 +
*** [[Ec-13_002810]]
 +
** 2 reconstruction source(s) associated:
 +
*** [[annotation-esiliculosus_genome]]
 +
*** [[orthology-aragem]]
 +
* [[RXN-12195]]
 +
** 9 associated gene(s):
 +
*** [[Ec-02_005730]]
 +
*** [[Ec-03_001180]]
 +
*** [[Ec-05_005340]]
 +
*** [[Ec-18_004660]]
 +
*** [[Ec-06_005470]]
 +
*** [[Ec-01_003690]]
 +
*** [[Ec-17_000870]]
 +
*** [[Ec-28_000420]]
 +
*** [[Ec-03_004860]]
 +
** 1 reconstruction source(s) associated:
 +
*** [[annotation-esiliculosus_genome]]
 +
* [[THYMIDYLATESYN-RXN]]
 +
** 1 associated gene(s):
 +
*** [[Ec-27_004630]]
 +
** 1 reconstruction source(s) associated:
 +
*** [[annotation-esiliculosus_genome]]
 +
* [[UDPREDUCT-RXN]]
 +
** 7 associated gene(s):
 +
*** [[Ec-19_000440]]
 +
*** [[Ec-21_002920]]
 +
*** [[Ec-17_003700]]
 +
*** [[Ec-11_002180]]
 +
*** [[Ec-06_005120]]
 +
*** [[Ec-06_005570]]
 +
*** [[Ec-11_002170]]
 +
** 2 reconstruction source(s) associated:
 +
*** [[annotation-esiliculosus_genome]]
 +
*** [[orthology-aragem]]
 +
== Reaction(s) not found ==
 
== External links  ==
 
== External links  ==
−
* CAS : 987-78-0
+
* ECOCYC:
−
* PUBCHEM:
+
** [http://metacyc.org/ECOLI/NEW-IMAGE?object=PWY-7184 PWY-7184]
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25202509 25202509]
+
{{#set: taxonomic range=TAX-2157}}
−
* CHEBI:
+
{{#set: taxonomic range=TAX-2759}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58779 58779]
+
{{#set: taxonomic range=TAX-2}}
−
* LIGAND-CPD:
+
{{#set: common name=pyrimidine deoxyribonucleotides de novo biosynthesis I}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C00307 C00307]
+
{{#set: reaction found=9}}
−
* HMDB : HMDB01413
+
{{#set: total reaction=9}}
−
{{#set: smiles=C[N+](C)(C)CCOP([O-])(=O)OP([O-])(=O)OCC1(OC(C(O)C(O)1)N2(C=CC(=NC2=O)N))}}
+
{{#set: completion rate=100.0}}
−
{{#set: inchi key=InChIKey=RZZPDXZPRHQOCG-OJAKKHQRSA-M}}
+
−
{{#set: common name=CDP-choline}}
+
−
{{#set: molecular weight=487.319    }}
+
−
{{#set: common name=citicoline|citicholine|cidifos|cyticholine|cytidine 5'-diphosphocholine|cytidine diphosphate choline}}
+
−
{{#set: produced by=2.7.7.15-RXN}}
+
−
{{#set: consumed or produced by=RXN-5781}}
+

Revision as of 20:54, 17 March 2018

Pathway PWY-7184

  • taxonomic range:
  • common name:
    • pyrimidine deoxyribonucleotides de novo biosynthesis I
  • Synonym(s):

Reaction(s) found

9 reactions found over 9 reactions in the full pathway

Reaction(s) not found

External links




Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=PWY-7184&oldid=10793"