Difference between revisions of "BETAINE ALDEHYDE"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=HOMO-SER HOMO-SER] == * smiles: ** C(CO)C([N+])C([O-])=O * inchi key: ** InChIKey=UKAUYVFTDYCKQ...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14926 CPD-14926] == * smiles: ** CC(C)CCCC(C)CCCC(C)CCCC(C)=C[CH]=O * inchi key: ** InChIKe...") |
||
| Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14926 CPD-14926] == |
* smiles: | * smiles: | ||
| − | ** C( | + | ** CC(C)CCCC(C)CCCC(C)CCCC(C)=C[CH]=O |
* inchi key: | * inchi key: | ||
| − | ** InChIKey= | + | ** InChIKey=RAFZYSUICBQABU-PYDDKJGSSA-N |
* common name: | * common name: | ||
| − | ** | + | ** phytenal |
* molecular weight: | * molecular weight: | ||
| − | ** | + | ** 294.52 |
* Synonym(s): | * Synonym(s): | ||
| − | ** | + | ** 2E-phytenal |
| − | ** | + | ** 3,7,11,15-tetramethyl-2E-hexadecenal |
| − | + | ||
| − | + | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[RXN66-479]] |
| − | + | ||
| − | + | ||
| − | + | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | |||
== External links == | == External links == | ||
| − | * | + | * LIPID_MAPS : LMPR0104010025 |
| − | + | ||
* PUBCHEM: | * PUBCHEM: | ||
| − | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=9900764 9900764] |
| − | + | {{#set: smiles=CC(C)CCCC(C)CCCC(C)CCCC(C)=C[CH]=O}} | |
| − | + | {{#set: inchi key=InChIKey=RAFZYSUICBQABU-PYDDKJGSSA-N}} | |
| − | + | {{#set: common name=phytenal}} | |
| − | + | {{#set: molecular weight=294.52 }} | |
| − | + | {{#set: common name=2E-phytenal|3,7,11,15-tetramethyl-2E-hexadecenal}} | |
| − | + | {{#set: consumed by=RXN66-479}} | |
| − | {{#set: smiles=C( | + | |
| − | {{#set: inchi key=InChIKey= | + | |
| − | {{#set: common name= | + | |
| − | {{#set: molecular weight= | + | |
| − | {{#set: common name= | + | |
| − | + | ||
| − | + | ||
| − | {{#set: consumed | + | |
Revision as of 20:54, 17 March 2018
Contents
Metabolite CPD-14926
- smiles:
- CC(C)CCCC(C)CCCC(C)CCCC(C)=C[CH]=O
- inchi key:
- InChIKey=RAFZYSUICBQABU-PYDDKJGSSA-N
- common name:
- phytenal
- molecular weight:
- 294.52
- Synonym(s):
- 2E-phytenal
- 3,7,11,15-tetramethyl-2E-hexadecenal
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- LIPID_MAPS : LMPR0104010025
- PUBCHEM:
"CC(C)CCCC(C)CCCC(C)CCCC(C)=C[CH]=O" cannot be used as a page name in this wiki.
