Difference between revisions of "CPD-11715"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=3-OXOACYL-ACP-REDUCT-RXN 3-OXOACYL-ACP-REDUCT-RXN] == * direction: ** LEFT-TO-RIGHT * common name:...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11715 CPD-11715] == * smiles: ** C(=O)(NCC(=O)[O-])CC1(C=CC=CC=1) * inchi key: ** InChIKey=...")
 
Line 1: Line 1:
[[Category:Reaction]]
+
[[Category:Metabolite]]
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=3-OXOACYL-ACP-REDUCT-RXN 3-OXOACYL-ACP-REDUCT-RXN] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11715 CPD-11715] ==
* direction:
+
* smiles:
** LEFT-TO-RIGHT
+
** C(=O)(NCC(=O)[O-])CC1(C=CC=CC=1)
 +
* inchi key:
 +
** InChIKey=UTYVDVLMYQPLQB-UHFFFAOYSA-M
 
* common name:
 
* common name:
** NAD(P)-binding domain
+
** phenylacetylglycine
* ec number:
+
* molecular weight:
** [http://enzyme.expasy.org/EC/2.3.1.86 EC-2.3.1.86]
+
** 192.194   
** [http://enzyme.expasy.org/EC/2.3.1.85 EC-2.3.1.85]
+
** [http://enzyme.expasy.org/EC/1.1.1.100 EC-1.1.1.100]
+
 
* Synonym(s):
 
* Synonym(s):
 +
** phenaceturic acid
 +
** phenacetylglycine
 +
** N-phenacetylglycine
 +
** N-phenylacetylglycine
 +
** N-(phenylacetyl)glycine
 +
** glycine, N-(phenylacetyl)-
  
== Reaction Formula ==
+
== Reaction(s) known to consume the compound ==
* With identifiers:
+
== Reaction(s) known to produce the compound ==
** 1 [[B-KETOACYL-ACP]][c] '''+''' 1 [[PROTON]][c] '''+''' 1 [[NADPH]][c] '''=>''' 1 [[OH-ACYL-ACP]][c] '''+''' 1 [[NADP]][c]
+
* [[RXN-10821]]
* With common name(s):
+
== Reaction(s) of unknown directionality ==
** 1 a 3-oxoacyl-[acp][c] '''+''' 1 H+[c] '''+''' 1 NADPH[c] '''=>''' 1 a (3R)-3-hydroxyacyl-[acyl-carrier protein][c] '''+''' 1 NADP+[c]
+
 
+
== Genes associated with this reaction  ==
+
Genes have been associated with this reaction based on different elements listed below.
+
* Gene: [[Ec-01_007100]]
+
** Source: [[annotation-esiliculosus_genome]]
+
*** Assignment: EC-NUMBER
+
== Pathways  ==
+
* [[FASYN-ELONG-PWY]], fatty acid elongation -- saturated: [http://metacyc.org/META/NEW-IMAGE?object=FASYN-ELONG-PWY FASYN-ELONG-PWY]
+
** '''3''' reactions found over '''5''' reactions in the full pathway
+
== Reconstruction information  ==
+
* Category: [[annotation]]
+
** Source: [[annotation-esiliculosus_genome]]
+
*** Tool: [[pathwaytools]]
+
 
== External links  ==
 
== External links  ==
* LIGAND-RXN:
+
* PUBCHEM:
** [http://www.genome.jp/dbget-bin/www_bget?R02767 R02767]
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=4229702 4229702]
* UNIPROT:
+
* CHEMSPIDER:
** [http://www.uniprot.org/uniprot/P49327 P49327]
+
** [http://www.chemspider.com/Chemical-Structure.3438658.html 3438658]
** [http://www.uniprot.org/uniprot/O25286 O25286]
+
* CHEBI:
** [http://www.uniprot.org/uniprot/P51831 P51831]
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=60874 60874]
** [http://www.uniprot.org/uniprot/Q9PI70 Q9PI70]
+
{{#set: smiles=C(=O)(NCC(=O)[O-])CC1(C=CC=CC=1)}}
** [http://www.uniprot.org/uniprot/P0AEK2 P0AEK2]
+
{{#set: inchi key=InChIKey=UTYVDVLMYQPLQB-UHFFFAOYSA-M}}
** [http://www.uniprot.org/uniprot/Q9ZLS0 Q9ZLS0]
+
{{#set: common name=phenylacetylglycine}}
** [http://www.uniprot.org/uniprot/P43713 P43713]
+
{{#set: molecular weight=192.194    }}
** [http://www.uniprot.org/uniprot/P14802 P14802]
+
{{#set: common name=phenaceturic acid|phenacetylglycine|N-phenacetylglycine|N-phenylacetylglycine|N-(phenylacetyl)glycine|glycine, N-(phenylacetyl)-}}
** [http://www.uniprot.org/uniprot/O32229 O32229]
+
{{#set: produced by=RXN-10821}}
** [http://www.uniprot.org/uniprot/Q9JW61 Q9JW61]
+
** [http://www.uniprot.org/uniprot/O34782 O34782]
+
** [http://www.uniprot.org/uniprot/O67610 O67610]
+
** [http://www.uniprot.org/uniprot/P27583 P27583]
+
** [http://www.uniprot.org/uniprot/P33207 P33207]
+
** [http://www.uniprot.org/uniprot/P27582 P27582]
+
** [http://www.uniprot.org/uniprot/P28643 P28643]
+
** [http://www.uniprot.org/uniprot/P73574 P73574]
+
** [http://www.uniprot.org/uniprot/O54438 O54438]
+
** [http://www.uniprot.org/uniprot/P55336 P55336]
+
** [http://www.uniprot.org/uniprot/Q9RA33 Q9RA33]
+
** [http://www.uniprot.org/uniprot/Q44326 Q44326]
+
** [http://www.uniprot.org/uniprot/P12276 P12276]
+
** [http://www.uniprot.org/uniprot/P12785 P12785]
+
{{#set: direction=LEFT-TO-RIGHT}}
+
{{#set: common name=NAD(P)-binding domain}}
+
{{#set: ec number=EC-2.3.1.86}}
+
{{#set: ec number=EC-2.3.1.85}}
+
{{#set: ec number=EC-1.1.1.100}}
+
{{#set: gene associated=Ec-01_007100}}
+
{{#set: in pathway=FASYN-ELONG-PWY}}
+
{{#set: reconstruction category=annotation}}
+
{{#set: reconstruction source=annotation-esiliculosus_genome}}
+
{{#set: reconstruction tool=pathwaytools}}
+

Latest revision as of 19:49, 21 March 2018

Metabolite CPD-11715

  • smiles:
    • C(=O)(NCC(=O)[O-])CC1(C=CC=CC=1)
  • inchi key:
    • InChIKey=UTYVDVLMYQPLQB-UHFFFAOYSA-M
  • common name:
    • phenylacetylglycine
  • molecular weight:
    • 192.194
  • Synonym(s):
    • phenaceturic acid
    • phenacetylglycine
    • N-phenacetylglycine
    • N-phenylacetylglycine
    • N-(phenylacetyl)glycine
    • glycine, N-(phenylacetyl)-

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"C(=O)(NCC(=O)[O-])CC1(C=CC=CC=1)" cannot be used as a page name in this wiki.