Difference between revisions of "RXN-16158"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=PSEUDOURIDINE-5-P PSEUDOURIDINE-5-P] == * smiles: ** C1(=C(C(=O)NC(=O)N1)C2(OC(COP(=O)([O-])[O-...")
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-16158 RXN-16158] == * direction: ** REVERSIBLE * common name: ** Lyso-phosphatidylcholine acylt...")
 
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Reaction]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=PSEUDOURIDINE-5-P PSEUDOURIDINE-5-P] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-16158 RXN-16158] ==
* smiles:
+
* direction:
** C1(=C(C(=O)NC(=O)N1)C2(OC(COP(=O)([O-])[O-])C(O)C(O)2))
+
** REVERSIBLE
* inchi key:
+
** InChIKey=MOBMOJGXNHLLIR-GBNDHIKLSA-L
+
 
* common name:
 
* common name:
** pseudouridine 5'-phosphate
+
** Lyso-phosphatidylcholine acyltransferase
* molecular weight:
+
* ec number:
** 322.168   
+
** [http://enzyme.expasy.org/EC/2.3.1.23 EC-2.3.1.23]
 
* Synonym(s):
 
* Synonym(s):
  
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
== Reaction(s) known to produce the compound ==
+
* With identifiers:
* [[PSEUDOURIDINE-KINASE-RXN]]
+
** 1 [[Glycerolipids]][c] '''+''' 1 [[CPD-15363]][c] '''<=>''' 1 [[CPD-17404]][c] '''+''' 1 [[CO-A]][c]
== Reaction(s) of unknown directionality ==
+
* With common name(s):
* [[RXN0-5398]]
+
** 1 a glycerolipid[c] '''+''' 1 (11Z)-icosenoyl-CoA[c] '''<=>''' 1 a [glycerolipid]-(11Z)-eicosenoate[c] '''+''' 1 coenzyme A[c]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* Gene: [[Ec-16_002160]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: AUTOMATED-NAME-MATCH
 +
== Pathways  ==
 +
* [[PWY-6433]], hydroxylated fatty acid biosynthesis (plants): [http://metacyc.org/META/NEW-IMAGE?object=PWY-6433 PWY-6433]
 +
** '''7''' reactions found over '''22''' reactions in the full pathway
 +
== Reconstruction information  ==
 +
* Category: [[annotation]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Tool: [[pathwaytools]]
 
== External links  ==
 
== External links  ==
* CAS : 1157-60-4
+
{{#set: direction=REVERSIBLE}}
* PUBCHEM:
+
{{#set: common name=Lyso-phosphatidylcholine acyltransferase}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25245232 25245232]
+
{{#set: ec number=EC-2.3.1.23}}
* CHEBI:
+
{{#set: gene associated=Ec-16_002160}}
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58380 58380]
+
{{#set: in pathway=PWY-6433}}
* LIGAND-CPD:
+
{{#set: reconstruction category=annotation}}
** [http://www.genome.jp/dbget-bin/www_bget?C01168 C01168]
+
{{#set: reconstruction source=annotation-esiliculosus_genome}}
* HMDB : HMDB01271
+
{{#set: reconstruction tool=pathwaytools}}
{{#set: smiles=C1(=C(C(=O)NC(=O)N1)C2(OC(COP(=O)([O-])[O-])C(O)C(O)2))}}
+
{{#set: inchi key=InChIKey=MOBMOJGXNHLLIR-GBNDHIKLSA-L}}
+
{{#set: common name=pseudouridine 5'-phosphate}}
+
{{#set: molecular weight=322.168    }}
+
{{#set: produced by=PSEUDOURIDINE-KINASE-RXN}}
+
{{#set: reversible reaction associated=RXN0-5398}}
+

Latest revision as of 19:49, 21 March 2018

Reaction RXN-16158

  • direction:
    • REVERSIBLE
  • common name:
    • Lyso-phosphatidylcholine acyltransferase
  • ec number:
  • Synonym(s):

Reaction Formula

  • With identifiers:
  • With common name(s):
    • 1 a glycerolipid[c] + 1 (11Z)-icosenoyl-CoA[c] <=> 1 a [glycerolipid]-(11Z)-eicosenoate[c] + 1 coenzyme A[c]

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

  • PWY-6433, hydroxylated fatty acid biosynthesis (plants): PWY-6433
    • 7 reactions found over 22 reactions in the full pathway

Reconstruction information

External links