Difference between revisions of "Ec-03 000720"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-206 CPD-206] == * smiles: ** CC(C)CCCC(C)CCCC(C)CCCC(C)CC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=...")
(Created page with "Category:Gene == Gene Ec-03_000720 == * Synonym(s): ** Esi_0027_0058 ** Esi0027_0058 == Reactions associated == * Reaction: RXN-8443 ** Source: orthology-aragem =...")
 
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-206 CPD-206] ==
+
== Gene Ec-03_000720 ==
−
* smiles:
+
−
** CC(C)CCCC(C)CCCC(C)CCCC(C)CC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])=O
+
−
* inchi key:
+
−
** InChIKey=NRJQGHHZMSOUEN-HHVNVSIESA-J
+
−
* common name:
+
−
** phytanoyl-CoA
+
−
* molecular weight:
+
−
** 1058.022   
+
 
* Synonym(s):
 
* Synonym(s):
 +
** Esi_0027_0058
 +
** Esi0027_0058
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
* [[1.14.11.18-RXN]]
+
* Reaction: [[RXN-8443]]
−
== Reaction(s) known to produce the compound ==
+
** Source: [[orthology-aragem]]
−
* [[RXN66-482]]
+
== Pathways associated ==
−
== Reaction(s) of unknown directionality ==
+
* [[PWY-5381]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: common name=Esi_0027_0058|Esi0027_0058}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90658363 90658363]
+
{{#set: reaction associated=RXN-8443}}
−
* CHEBI:
+
{{#set: pathway associated=PWY-5381}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=15538 15538]
+
−
* LIGAND-CPD:
+
−
** [http://www.genome.jp/dbget-bin/www_bget?C02060 C02060]
+
−
* HMDB : HMDB01359
+
−
{{#set: smiles=CC(C)CCCC(C)CCCC(C)CCCC(C)CC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])=O}}
+
−
{{#set: inchi key=InChIKey=NRJQGHHZMSOUEN-HHVNVSIESA-J}}
+
−
{{#set: common name=phytanoyl-CoA}}
+
−
{{#set: molecular weight=1058.022    }}
+
−
{{#set: consumed by=1.14.11.18-RXN}}
+
−
{{#set: produced by=RXN66-482}}
+

Latest revision as of 19:49, 21 March 2018

Gene Ec-03_000720

  • Synonym(s):
    • Esi_0027_0058
    • Esi0027_0058

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=Ec-03_000720&oldid=29572"