Difference between revisions of "Ec-14 005870"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=HYDRPHENYLAC-CPD HYDRPHENYLAC-CPD] == * smiles: ** [CH](=O)CC1(C=CC(O)=CC=1) * inchi key: ** In...") |
(Created page with "Category:Gene == Gene Ec-14_005870 == * left end position: ** 5431780 * transcription direction: ** NEGATIVE * right end position: ** 5447107 * centisome position: ** 82.7...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Ec-14_005870 == |
− | * | + | * left end position: |
− | ** | + | ** 5431780 |
− | * | + | * transcription direction: |
− | ** | + | ** NEGATIVE |
− | * | + | * right end position: |
− | ** | + | ** 5447107 |
− | * | + | * centisome position: |
− | ** | + | ** 82.79612 |
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** Esi_0133_0013 |
+ | ** Esi0133_0013 | ||
− | == | + | == Reactions associated == |
− | + | * Reaction: [[6-PHOSPHOFRUCTO-2-KINASE-RXN]] | |
− | * [[ | + | ** Source: [[annotation-esiliculosus_genome]] |
− | == | + | *** Assignment: go-term |
+ | == Pathways associated == | ||
+ | * [[PWY66-423]] | ||
== External links == | == External links == | ||
− | + | {{#set: left end position=5431780}} | |
− | + | {{#set: transcription direction=NEGATIVE}} | |
− | + | {{#set: right end position=5447107}} | |
− | + | {{#set: centisome position=82.79612 }} | |
− | + | {{#set: common name=Esi_0133_0013|Esi0133_0013}} | |
− | + | {{#set: reaction associated=6-PHOSPHOFRUCTO-2-KINASE-RXN}} | |
− | + | {{#set: pathway associated=PWY66-423}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: common name= | + | |
− | {{#set: | + |
Latest revision as of 19:49, 21 March 2018
Gene Ec-14_005870
- left end position:
- 5431780
- transcription direction:
- NEGATIVE
- right end position:
- 5447107
- centisome position:
- 82.79612
- Synonym(s):
- Esi_0133_0013
- Esi0133_0013
Reactions associated
- Reaction: 6-PHOSPHOFRUCTO-2-KINASE-RXN
- Source: annotation-esiliculosus_genome
- Assignment: go-term
- Source: annotation-esiliculosus_genome