Difference between revisions of "CPD1F-120"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RIBULP3EPIM-RXN RIBULP3EPIM-RXN] == * direction: ** REVERSIBLE * common name: ** Ribulose-phosphate...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD1F-120 CPD1F-120] == * smiles: ** C=C1(C2(CC3(C1)(C([CH]4(C(C)(CCCC(C=O)([CH](CC2)3)4)C([O-]...")
 
Line 1: Line 1:
−
[[Category:Reaction]]
+
[[Category:Metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RIBULP3EPIM-RXN RIBULP3EPIM-RXN] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD1F-120 CPD1F-120] ==
−
* direction:
+
* smiles:
−
** REVERSIBLE
+
** C=C1(C2(CC3(C1)(C([CH]4(C(C)(CCCC(C=O)([CH](CC2)3)4)C([O-])=O))C([O-])=O)))
 +
* inchi key:
 +
** InChIKey=QQRSSHFHXYSOMF-CXXOJBQZSA-L
 
* common name:
 
* common name:
−
** Ribulose-phosphate 3-epimerase-like
+
** gibberellin A24
−
* ec number:
+
* molecular weight:
−
** [http://enzyme.expasy.org/EC/5.1.3.1 EC-5.1.3.1]
+
** 344.407   
 
* Synonym(s):
 
* Synonym(s):
 +
** GA24
  
−
== Reaction Formula ==
+
== Reaction(s) known to consume the compound ==
−
* With identifiers:
+
== Reaction(s) known to produce the compound ==
−
** 1 [[RIBULOSE-5P]][c] '''<=>''' 1 [[XYLULOSE-5-PHOSPHATE]][c]
+
* [[RXN1F-163]]
−
* With common name(s):
+
== Reaction(s) of unknown directionality ==
−
** 1 D-ribulose 5-phosphate[c] '''<=>''' 1 D-xylulose 5-phosphate[c]
+
−
 
+
−
== Genes associated with this reaction  ==
+
−
Genes have been associated with this reaction based on different elements listed below.
+
−
* Gene: [[Ec-07_002390]]
+
−
** Source: [[annotation-esiliculosus_genome]]
+
−
*** Assignment: EC-NUMBER
+
−
** Source: [[orthology-aragem]]
+
−
** Source: [[orthology-aragem]]
+
−
* Gene: [[Ec-27_003930]]
+
−
** Source: [[annotation-esiliculosus_genome]]
+
−
*** Assignment: EC-NUMBER
+
−
** Source: [[orthology-aragem]]
+
−
** Source: [[orthology-aragem]]
+
−
== Pathways  ==
+
−
* [[P124-PWY]], Bifidobacterium shunt: [http://metacyc.org/META/NEW-IMAGE?object=P124-PWY P124-PWY]
+
−
** '''12''' reactions found over '''15''' reactions in the full pathway
+
−
* [[CALVIN-PWY]], Calvin-Benson-Bassham cycle: [http://metacyc.org/META/NEW-IMAGE?object=CALVIN-PWY CALVIN-PWY]
+
−
** '''13''' reactions found over '''13''' reactions in the full pathway
+
−
* [[P21-PWY]], pentose phosphate pathway (partial): [http://metacyc.org/META/NEW-IMAGE?object=P21-PWY P21-PWY]
+
−
** '''3''' reactions found over '''3''' reactions in the full pathway
+
−
* [[PWY-5723]], Rubisco shunt: [http://metacyc.org/META/NEW-IMAGE?object=PWY-5723 PWY-5723]
+
−
** '''10''' reactions found over '''10''' reactions in the full pathway
+
−
* [[PWY-1861]], formaldehyde assimilation II (RuMP Cycle): [http://metacyc.org/META/NEW-IMAGE?object=PWY-1861 PWY-1861]
+
−
** '''7''' reactions found over '''9''' reactions in the full pathway
+
−
* [[P122-PWY]], heterolactic fermentation: [http://metacyc.org/META/NEW-IMAGE?object=P122-PWY P122-PWY]
+
−
** '''13''' reactions found over '''18''' reactions in the full pathway
+
−
* [[P185-PWY]], formaldehyde assimilation III (dihydroxyacetone cycle): [http://metacyc.org/META/NEW-IMAGE?object=P185-PWY P185-PWY]
+
−
** '''11''' reactions found over '''12''' reactions in the full pathway
+
−
* [[NONOXIPENT-PWY]], pentose phosphate pathway (non-oxidative branch): [http://metacyc.org/META/NEW-IMAGE?object=NONOXIPENT-PWY NONOXIPENT-PWY]
+
−
** '''5''' reactions found over '''5''' reactions in the full pathway
+
−
== Reconstruction information  ==
+
−
* Category: [[orthology]]
+
−
** Source: [[orthology-aragem]]
+
−
*** Tool: [[pantograph]]
+
−
* Category: [[annotation]]
+
−
** Source: [[annotation-esiliculosus_genome]]
+
−
*** Tool: [[pathwaytools]]
+
 
== External links  ==
 
== External links  ==
−
* RHEA:
+
* PUBCHEM:
−
** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=13677 13677]
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25246232 25246232]
−
* LIGAND-RXN:
+
* CHEBI:
−
** [http://www.genome.jp/dbget-bin/www_bget?R01529 R01529]
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=32906 32906]
−
* UNIPROT:
+
* LIGAND-CPD:
−
** [http://www.uniprot.org/uniprot/P40117 P40117]
+
** [http://www.genome.jp/dbget-bin/www_bget?C11861 C11861]
−
** [http://www.uniprot.org/uniprot/Q9CEB9 Q9CEB9]
+
* HMDB : HMDB37103
−
** [http://www.uniprot.org/uniprot/P0AG07 P0AG07]
+
{{#set: smiles=C=C1(C2(CC3(C1)(C([CH]4(C(C)(CCCC(C=O)([CH](CC2)3)4)C([O-])=O))C([O-])=O)))}}
−
** [http://www.uniprot.org/uniprot/Q9PI57 Q9PI57]
+
{{#set: inchi key=InChIKey=QQRSSHFHXYSOMF-CXXOJBQZSA-L}}
−
** [http://www.uniprot.org/uniprot/Q9JUA9 Q9JUA9]
+
{{#set: common name=gibberellin A24}}
−
** [http://www.uniprot.org/uniprot/P45455 P45455]
+
{{#set: molecular weight=344.407    }}
−
** [http://www.uniprot.org/uniprot/Q43157 Q43157]
+
{{#set: common name=GA24}}
−
** [http://www.uniprot.org/uniprot/Q43843 Q43843]
+
{{#set: produced by=RXN1F-163}}
−
** [http://www.uniprot.org/uniprot/P74061 P74061]
+
−
** [http://www.uniprot.org/uniprot/O23782 O23782]
+
−
** [http://www.uniprot.org/uniprot/P51012 P51012]
+
−
{{#set: direction=REVERSIBLE}}
+
−
{{#set: common name=Ribulose-phosphate 3-epimerase-like}}
+
−
{{#set: ec number=EC-5.1.3.1}}
+
−
{{#set: gene associated=Ec-07_002390|Ec-27_003930}}
+
−
{{#set: in pathway=P124-PWY|CALVIN-PWY|P21-PWY|PWY-5723|PWY-1861|P122-PWY|P185-PWY|NONOXIPENT-PWY}}
+
−
{{#set: reconstruction category=orthology|annotation}}
+
−
{{#set: reconstruction source=annotation-esiliculosus_genome|orthology-aragem}}
+
−
{{#set: reconstruction tool=pantograph|pathwaytools}}
+

Latest revision as of 19:50, 21 March 2018

Metabolite CPD1F-120

  • smiles:
    • C=C1(C2(CC3(C1)(C([CH]4(C(C)(CCCC(C=O)([CH](CC2)3)4)C([O-])=O))C([O-])=O)))
  • inchi key:
    • InChIKey=QQRSSHFHXYSOMF-CXXOJBQZSA-L
  • common name:
    • gibberellin A24
  • molecular weight:
    • 344.407
  • Synonym(s):
    • GA24

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"C=C1(C2(CC3(C1)(C([CH]4(C(C)(CCCC(C=O)([CH](CC2)3)4)C([O-])=O))C([O-])=O)))" cannot be used as a page name in this wiki.



Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=CPD1F-120&oldid=29665"